(2R,3S)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-3-hydroxy-N,2-dimethyldecanamide

ID: ALA4744121

PubChem CID: 162646194

Max Phase: Preclinical

Molecular Formula: C28H47N3O5

Molecular Weight: 505.70

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC[C@H](O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C

Standard InChI:  InChI=1S/C28H47N3O5/c1-8-9-10-11-12-13-24(32)20(4)27(34)30(5)23(18-21-14-16-22(36-7)17-15-21)28(35)31(6)25(19(2)3)26(29)33/h14-17,19-20,23-25,32H,8-13,18H2,1-7H3,(H2,29,33)/t20-,23-,24+,25+/m1/s1

Standard InChI Key:  MSWMRUPSAFXMME-GATIMQMVSA-N

Molfile:  

 
     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
   21.9307  -12.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9295  -13.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6376  -14.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3472  -13.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3444  -12.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6358  -12.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2215  -14.1004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5141  -13.6912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0506  -12.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7598  -12.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4660  -12.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7629  -13.6810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0567  -14.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4721  -14.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4752  -14.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1783  -13.6757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7691  -15.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0598  -14.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3536  -15.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6444  -14.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9382  -15.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2290  -14.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5228  -15.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8136  -14.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1752  -12.8585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4629  -11.6354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1691  -11.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7537  -11.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8783  -11.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5845  -11.2188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8814  -12.4473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1660  -10.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8721   -9.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4567  -10.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7721  -16.1326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1845  -15.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  5  9  1  0
 10  9  1  6
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 11 25  2  0
 11 26  1  0
 26 27  1  0
 26 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 27 32  1  1
 32 33  1  0
 32 34  1  0
 17 35  1  1
 15 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4744121

    ---

Associated Targets(non-human)

MC3T3-E1 (421 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.70Molecular Weight (Monoisotopic): 505.3516AlogP: 3.39#Rotatable Bonds: 16
Polar Surface Area: 113.17Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: 0.66

References

1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T.  (2020)  Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity.,  83  (8.0): [PMID:32786886] [10.1021/acs.jnatprod.0c00441]

Source