The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-3-hydroxy-N,2-dimethyldecanamide ID: ALA4744121
PubChem CID: 162646194
Max Phase: Preclinical
Molecular Formula: C28H47N3O5
Molecular Weight: 505.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC[C@H](O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C
Standard InChI: InChI=1S/C28H47N3O5/c1-8-9-10-11-12-13-24(32)20(4)27(34)30(5)23(18-21-14-16-22(36-7)17-15-21)28(35)31(6)25(19(2)3)26(29)33/h14-17,19-20,23-25,32H,8-13,18H2,1-7H3,(H2,29,33)/t20-,23-,24+,25+/m1/s1
Standard InChI Key: MSWMRUPSAFXMME-GATIMQMVSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
21.9307 -12.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9295 -13.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6376 -14.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3472 -13.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3444 -12.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6358 -12.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2215 -14.1004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5141 -13.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0506 -12.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7598 -12.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4660 -12.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7629 -13.6810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0567 -14.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4721 -14.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4752 -14.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1783 -13.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7691 -15.3154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0598 -14.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3536 -15.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6444 -14.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9382 -15.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2290 -14.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5228 -15.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8136 -14.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1752 -12.8585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4629 -11.6354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1691 -11.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7537 -11.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8783 -11.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5845 -11.2188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8814 -12.4473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1660 -10.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8721 -9.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4567 -10.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7721 -16.1326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1845 -15.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
10 9 1 6
10 11 1 0
10 12 1 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
11 25 2 0
11 26 1 0
26 27 1 0
26 28 1 0
27 29 1 0
29 30 1 0
29 31 2 0
27 32 1 1
32 33 1 0
32 34 1 0
17 35 1 1
15 36 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.70Molecular Weight (Monoisotopic): 505.3516AlogP: 3.39#Rotatable Bonds: 16Polar Surface Area: 113.17Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.85CX LogD: 3.85Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: 0.66
References 1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T. (2020) Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity., 83 (8.0): [PMID:32786886 ] [10.1021/acs.jnatprod.0c00441 ]