Methyl 4-([1,1'-biphenyl]-4-amido)benzoate

ID: ALA4744181

PubChem CID: 2838376

Max Phase: Preclinical

Molecular Formula: C21H17NO3

Molecular Weight: 331.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(NC(=O)c2ccc(-c3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C21H17NO3/c1-25-21(24)18-11-13-19(14-12-18)22-20(23)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-14H,1H3,(H,22,23)

Standard InChI Key:  QCTICHATLVVKFU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   14.0129   -9.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8379   -9.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2547  -10.3054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2462   -8.8765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0712   -8.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4859   -9.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3101   -9.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7192   -8.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2981   -8.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4752   -8.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5468   -8.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9645   -9.5695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9542   -8.1406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7895   -9.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5992   -8.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7750   -8.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6099  -10.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7870  -10.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3675   -9.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5445   -9.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1274   -8.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3032   -8.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8950   -9.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3171  -10.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1399  -10.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  1  0
 11 13  2  0
  8 11  1  0
 12 14  1  0
  1 15  2  0
 15 16  1  0
 16 19  2  0
 18 17  2  0
 17  1  1  0
 18 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 20  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Streptococcus mutans (2687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 331.37Molecular Weight (Monoisotopic): 331.1208AlogP: 4.39#Rotatable Bonds: 4
Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.72CX LogD: 4.72
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -0.87

References

1. Nijampatnam B,Ahirwar P,Pukkanasut P,Womack H,Casals L,Zhang H,Cai X,Michalek SM,Wu H,Velu SE.  (2021)  Discovery of Potent Inhibitors of Streptococcus mutans Biofilm with Antivirulence Activity.,  12  (1): [PMID:33488963] [10.1021/acsmedchemlett.0c00373]

Source