The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(6-methoxyquinolin-4-yl)ethyl)-trans-1,3-dioxan-5-yl)-4-(trifluoromethoxy)benzamide ID: ALA4744292
PubChem CID: 162645888
Max Phase: Preclinical
Molecular Formula: C24H23F3N2O5
Molecular Weight: 476.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nccc(CC[C@H]3OC[C@H](NC(=O)c4ccc(OC(F)(F)F)cc4)CO3)c2c1
Standard InChI: InChI=1S/C24H23F3N2O5/c1-31-19-7-8-21-20(12-19)15(10-11-28-21)4-9-22-32-13-17(14-33-22)29-23(30)16-2-5-18(6-3-16)34-24(25,26)27/h2-3,5-8,10-12,17,22H,4,9,13-14H2,1H3,(H,29,30)/t17-,22-
Standard InChI Key: ANZYTNOCTRJHJE-VVOJOOEHSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
19.7072 -20.1766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4210 -19.7630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4182 -18.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7055 -18.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9951 -19.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9974 -18.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2873 -18.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5786 -18.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5803 -19.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2868 -20.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8667 -18.5316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7020 -17.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4120 -17.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1256 -17.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1245 -18.5238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8340 -18.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5465 -18.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5449 -17.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8309 -17.2847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2544 -18.9294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9660 -18.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6781 -18.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9656 -17.6991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8645 -17.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6764 -19.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3876 -20.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0982 -19.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0930 -18.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3813 -18.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8076 -20.1504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5136 -19.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2230 -20.1443 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.5100 -18.9216 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.2179 -19.3237 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
8 11 1 0
4 12 1 0
12 13 1 0
14 13 1 1
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
17 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
11 24 1 0
22 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 22 1 0
27 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.45Molecular Weight (Monoisotopic): 476.1559AlogP: 4.25#Rotatable Bonds: 7Polar Surface Area: 78.91Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.22CX LogP: 4.83CX LogD: 4.83Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -0.59
References 1. Lu Y,Papa JL,Nolan S,English A,Seffernick JT,Shkolnikov N,Powell J,Lindert S,Wozniak DJ,Yalowich J,Mitton-Fry MJ. (2020) Dioxane-Linked Amide Derivatives as Novel Bacterial Topoisomerase Inhibitors against Gram-Positive Staphylococcus aureus., 11 (12): [PMID:33335666 ] [10.1021/acsmedchemlett.0c00428 ]