4-Oxo-N-(2-((4-(trifluoromethyl)benzyl)oxy)ethyl)-6-(3-(trifluoromethyl)phenyl)-3,4-dihydroquinazoline-7-carboxamide

ID: ALA4744352

PubChem CID: 162648588

Max Phase: Preclinical

Molecular Formula: C26H19F6N3O3

Molecular Weight: 535.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCOCc1ccc(C(F)(F)F)cc1)c1cc2nc[nH]c(=O)c2cc1-c1cccc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C26H19F6N3O3/c27-25(28,29)17-6-4-15(5-7-17)13-38-9-8-33-23(36)20-12-22-21(24(37)35-14-34-22)11-19(20)16-2-1-3-18(10-16)26(30,31)32/h1-7,10-12,14H,8-9,13H2,(H,33,36)(H,34,35,37)

Standard InChI Key:  ZBGLQGLFVXNVNP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    8.4318  -27.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4305  -28.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1454  -29.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1436  -27.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8589  -27.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8624  -28.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5816  -29.0276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3020  -28.6105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2985  -27.7774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5747  -27.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5702  -26.5366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7172  -27.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7204  -26.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0067  -26.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2913  -26.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2943  -27.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7158  -29.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0016  -28.6132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7152  -29.8512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0024  -27.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2869  -29.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5727  -28.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8580  -29.0240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1438  -28.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4291  -29.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7176  -28.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0033  -29.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0022  -29.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7213  -30.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4327  -29.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2886  -30.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5889  -29.7881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2638  -31.0904    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.5724  -30.5661    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0036  -25.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7607  -24.9450    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2725  -24.8849    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.9777  -24.5412    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 20  2  0
 20 12  1  0
  2 17  1  0
 17 18  1  0
 17 19  2  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 28 31  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
 14 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744352

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.44Molecular Weight (Monoisotopic): 535.1331AlogP: 5.57#Rotatable Bonds: 7
Polar Surface Area: 84.08Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.12CX Basic pKa: 3.95CX LogP: 4.88CX LogD: 4.88
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.09

References

1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G.  (2020)  Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy.,  207  [PMID:32920426] [10.1016/j.ejmech.2020.112723]

Source