The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Oxo-N-(2-((4-(trifluoromethyl)benzyl)oxy)ethyl)-6-(3-(trifluoromethyl)phenyl)-3,4-dihydroquinazoline-7-carboxamide ID: ALA4744352
PubChem CID: 162648588
Max Phase: Preclinical
Molecular Formula: C26H19F6N3O3
Molecular Weight: 535.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCOCc1ccc(C(F)(F)F)cc1)c1cc2nc[nH]c(=O)c2cc1-c1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C26H19F6N3O3/c27-25(28,29)17-6-4-15(5-7-17)13-38-9-8-33-23(36)20-12-22-21(24(37)35-14-34-22)11-19(20)16-2-1-3-18(10-16)26(30,31)32/h1-7,10-12,14H,8-9,13H2,(H,33,36)(H,34,35,37)
Standard InChI Key: ZBGLQGLFVXNVNP-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
8.4318 -27.7869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4305 -28.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1454 -29.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1436 -27.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8589 -27.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8624 -28.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5816 -29.0276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3020 -28.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2985 -27.7774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5747 -27.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5702 -26.5366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7172 -27.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7204 -26.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0067 -26.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2913 -26.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2943 -27.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7158 -29.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0016 -28.6132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7152 -29.8512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0024 -27.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2869 -29.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5727 -28.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8580 -29.0240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1438 -28.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4291 -29.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7176 -28.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0033 -29.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0022 -29.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7213 -30.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4327 -29.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2886 -30.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5889 -29.7881 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2638 -31.0904 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.5724 -30.5661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0036 -25.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7607 -24.9450 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.2725 -24.8849 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.9777 -24.5412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
1 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 20 2 0
20 12 1 0
2 17 1 0
17 18 1 0
17 19 2 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 32 1 0
31 33 1 0
31 34 1 0
28 31 1 0
35 36 1 0
35 37 1 0
35 38 1 0
14 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.44Molecular Weight (Monoisotopic): 535.1331AlogP: 5.57#Rotatable Bonds: 7Polar Surface Area: 84.08Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.12CX Basic pKa: 3.95CX LogP: 4.88CX LogD: 4.88Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.09
References 1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G. (2020) Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy., 207 [PMID:32920426 ] [10.1016/j.ejmech.2020.112723 ]