The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-7-(2-Fluoro-6-hydroxyphenyl)-4-(4-(2-fluoroacryloyl)-2-methylpiperazin-1-yl)-1-(2-isopropyl-4-methylpyridin-3-yl)pyrido[4,3-d]pyrimidin-2(1H)-one ID: ALA4744397
PubChem CID: 162649033
Max Phase: Preclinical
Molecular Formula: C30H30F2N6O3
Molecular Weight: 560.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C(F)C(=O)N1CCN(c2nc(=O)n(-c3c(C)ccnc3C(C)C)c3cc(-c4c(O)cccc4F)ncc23)[C@@H](C)C1
Standard InChI: InChI=1S/C30H30F2N6O3/c1-16(2)26-27(17(3)9-10-33-26)38-23-13-22(25-21(32)7-6-8-24(25)39)34-14-20(23)28(35-30(38)41)37-12-11-36(15-18(37)4)29(40)19(5)31/h6-10,13-14,16,18,39H,5,11-12,15H2,1-4H3/t18-/m0/s1
Standard InChI Key: PSFLJIUPYUMLJY-SFHVURJKSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
3.0527 -5.7666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0516 -6.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7663 -7.0068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7646 -5.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4800 -5.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4807 -6.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1961 -7.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9110 -6.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9063 -5.7561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1904 -5.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6236 -6.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6254 -7.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3406 -8.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0545 -7.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0485 -6.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3328 -6.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7583 -4.5306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4733 -4.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4728 -3.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7590 -2.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0439 -3.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0427 -4.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3273 -5.7519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9121 -8.2323 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7596 -2.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4744 -1.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4750 -0.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0454 -1.6435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3290 -4.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3368 -7.0059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7692 -7.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0540 -8.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0555 -9.0656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7715 -9.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4874 -9.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4823 -8.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1946 -7.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3389 -7.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6251 -8.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9209 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1885 -2.0578 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
8 11 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
4 17 1 0
16 23 1 0
12 24 1 0
20 25 1 0
25 26 1 0
26 27 2 0
25 28 2 0
22 29 1 1
2 30 2 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
3 31 1 0
36 37 1 0
32 38 1 0
38 39 1 0
38 40 1 0
26 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.61Molecular Weight (Monoisotopic): 560.2347AlogP: 4.64#Rotatable Bonds: 5Polar Surface Area: 104.45Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.25CX Basic pKa: 4.79CX LogP: 3.93CX LogD: 3.55Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.35Np Likeness Score: -0.74
References 1. Xiao X,Lai M,Song Z,Geng M,Ding J,Xie H,Zhang A. (2021) Design, synthesis and pharmacological evaluation of bicyclic and tetracyclic pyridopyrimidinone analogues as new KRAS inhibitors., 213 [PMID:33309163 ] [10.1016/j.ejmech.2020.113082 ]