The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-(6-cyclopropylpyridin-3-yl)-N-(6-(4-isopropyl-4H-1,2,4-triazol-3-yl)pyridin-2-yl)morpholine-2-carboxamide ID: ALA4744428
PubChem CID: 162647791
Max Phase: Preclinical
Molecular Formula: C23H27N7O2
Molecular Weight: 433.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)n1cnnc1-c1cccc(NC(=O)[C@H]2CN(c3ccc(C4CC4)nc3)CCO2)n1
Standard InChI: InChI=1S/C23H27N7O2/c1-15(2)30-14-25-28-22(30)19-4-3-5-21(26-19)27-23(31)20-13-29(10-11-32-20)17-8-9-18(24-12-17)16-6-7-16/h3-5,8-9,12,14-16,20H,6-7,10-11,13H2,1-2H3,(H,26,27,31)/t20-/m1/s1
Standard InChI Key: YFDUEWUWHYXMLI-HXUWFJFHSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
35.5857 -18.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5846 -18.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2994 -19.2651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0158 -18.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0130 -18.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2976 -17.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7315 -19.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8190 -20.0810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6263 -20.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0377 -19.5360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4846 -18.9240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2068 -20.6339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4218 -20.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3796 -21.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8698 -19.2641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1557 -18.8511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1563 -18.0261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4408 -19.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7275 -18.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0132 -19.2589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0121 -20.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7312 -20.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4426 -20.0841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2993 -18.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3026 -18.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5896 -17.6101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8736 -18.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8751 -18.8511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5889 -19.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1585 -17.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7459 -16.8965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3335 -17.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
4 7 1 0
8 12 1 0
12 13 1 0
12 14 1 0
15 2 1 0
15 16 1 0
16 17 2 0
18 16 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 18 1 0
20 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
31 30 1 0
32 31 1 0
30 32 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.52Molecular Weight (Monoisotopic): 433.2226AlogP: 3.04#Rotatable Bonds: 6Polar Surface Area: 98.06Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.50CX Basic pKa: 5.61CX LogP: 2.39CX LogD: 2.38Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -1.75
References 1. Bigi-Botterill SV,Ivetac A,Bradshaw EL,Cole D,Dougan DR,Ermolieff J,Halkowycz P,Johnson B,McBride C,Pickens J,Sabat M,Swann S. (2020) Structure-guided optimization of a novel class of ASK1 inhibitors with increased sp character and an exquisite selectivity profile., 30 (17): [PMID:32738982 ] [10.1016/j.bmcl.2020.127405 ]