The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-N-[(1R,2R)-2-(benzyloxy)-1-cyanopropyl]-2-[(3-bromophenyl)formamido]-3-(3-chlorophenyl)propanamide ID: ALA4744431
PubChem CID: 162647794
Max Phase: Preclinical
Molecular Formula: C27H25BrClN3O3
Molecular Weight: 554.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](OCc1ccccc1)[C@@H](C#N)NC(=O)[C@H](Cc1cccc(Cl)c1)NC(=O)c1cccc(Br)c1
Standard InChI: InChI=1S/C27H25BrClN3O3/c1-18(35-17-19-7-3-2-4-8-19)25(16-30)32-27(34)24(14-20-9-5-12-23(29)13-20)31-26(33)21-10-6-11-22(28)15-21/h2-13,15,18,24-25H,14,17H2,1H3,(H,31,33)(H,32,34)/t18-,24+,25-/m1/s1
Standard InChI Key: ZGXKAZRUQQNMKC-AYCKEJKLSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
5.7781 -24.9491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4900 -24.5364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1977 -24.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1977 -25.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9095 -24.5364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6180 -24.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6195 -25.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3279 -26.1682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3294 -26.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0379 -27.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0362 -28.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7438 -28.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4517 -28.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4476 -27.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7394 -26.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4910 -23.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1992 -23.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9045 -23.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6122 -23.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6137 -22.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9016 -22.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1967 -22.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8997 -21.2730 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.3249 -24.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9125 -26.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0296 -24.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0697 -24.5418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0682 -23.7246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3627 -24.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6571 -24.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9506 -24.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9516 -25.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6651 -26.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3686 -25.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6695 -26.9942 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
6 24 1 6
7 25 1 6
24 26 3 0
1 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.87Molecular Weight (Monoisotopic): 553.0768AlogP: 5.06#Rotatable Bonds: 10Polar Surface Area: 91.22Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.16CX Basic pKa: ┄CX LogP: 5.38CX LogD: 5.38Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -0.76
References 1. Cianni L,Rocho FDR,Bonatto V,Martins FCP,Lameira J,Leitão A,Montanari CA,Shamim A. (2021) Design, synthesis and stepwise optimization of nitrile-based inhibitors of cathepsins B and L., 29 [PMID:33254069 ] [10.1016/j.bmc.2020.115827 ]