Ethyl 4-(4-(1-(3,4-dimethylphenyl)-4-oxo-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)phenoxy)butanoate

ID: ALA4744436

PubChem CID: 162647797

Max Phase: Preclinical

Molecular Formula: C25H26N4O4

Molecular Weight: 446.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CCCOc1ccc(-c2nc3c(cnn3-c3ccc(C)c(C)c3)c(=O)[nH]2)cc1

Standard InChI:  InChI=1S/C25H26N4O4/c1-4-32-22(30)6-5-13-33-20-11-8-18(9-12-20)23-27-24-21(25(31)28-23)15-26-29(24)19-10-7-16(2)17(3)14-19/h7-12,14-15H,4-6,13H2,1-3H3,(H,27,28,31)

Standard InChI Key:  FWZPUZSQYZWATJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   20.1849   -3.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1838   -4.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8994   -4.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6164   -4.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6136   -3.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8975   -3.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3243   -3.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0371   -3.6970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0259   -2.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3198   -2.4656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7477   -2.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7506   -3.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5354   -3.5330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0190   -2.8638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5305   -2.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7933   -4.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2401   -4.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4961   -5.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3047   -5.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8569   -5.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5981   -4.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0199   -1.2214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4682   -4.9447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7534   -4.5294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0379   -4.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3229   -4.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6116   -4.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8967   -4.5272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1811   -4.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6110   -5.7676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6611   -5.4269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5624   -6.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4697   -4.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
 10  7  1  0
  5  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  9 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  2  0
 20 31  1  0
 19 32  1  0
 29 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744436

    ---

Associated Targets(non-human)

L6 (7924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.1954AlogP: 4.11#Rotatable Bonds: 8
Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.24CX Basic pKa: CX LogP: 4.18CX LogD: 4.17
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -1.55

References

1. Gupta S,Rai AK,Pandey S,Singh LR,Kant R,Tamrakar AK,Sashidhara KV.  (2021)  Microwave-assisted efficient synthesis of pyrazole-fibrate derivatives as stimulators of glucose uptake in skeletal muscle cells.,  34  [PMID:33359606] [10.1016/j.bmcl.2020.127760]

Source