The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((5-chloro-2-((2-methoxy-4-(((5-(piperidin-1-ylmethyl)furan-2-yl)methyl)amino)phenyl)amino)pyrimidin-4-yl)amino)phenyl)methanesulfonamide ID: ALA4744461
PubChem CID: 162648034
Max Phase: Preclinical
Molecular Formula: C29H34ClN7O4S
Molecular Weight: 612.16
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NCc2ccc(CN3CCCCC3)o2)ccc1Nc1ncc(Cl)c(Nc2ccccc2NS(C)(=O)=O)n1
Standard InChI: InChI=1S/C29H34ClN7O4S/c1-40-27-16-20(31-17-21-11-12-22(41-21)19-37-14-6-3-7-15-37)10-13-26(27)34-29-32-18-23(30)28(35-29)33-24-8-4-5-9-25(24)36-42(2,38)39/h4-5,8-13,16,18,31,36H,3,6-7,14-15,17,19H2,1-2H3,(H2,32,33,34,35)
Standard InChI Key: MQFRVLYTVZHSSV-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
0.3756 -21.5895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1928 -21.5895 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.7842 -20.8818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1955 -19.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1943 -19.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9024 -20.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6120 -19.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6092 -19.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9006 -18.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9022 -21.1836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1942 -22.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3204 -20.3645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0275 -19.9548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7325 -20.3627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4391 -19.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4382 -19.1356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7249 -18.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0212 -19.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3109 -18.7357 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.1472 -20.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8545 -19.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5616 -20.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2684 -19.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2680 -19.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5549 -18.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8510 -19.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5614 -21.1788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8536 -21.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9747 -18.7245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6834 -19.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3901 -18.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1355 -19.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6809 -18.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2705 -17.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4717 -17.9074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6010 -16.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4135 -16.9006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8895 -17.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6986 -17.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0331 -16.7300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5522 -16.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7367 -16.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
10 2 1 0
2 11 1 0
7 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
15 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
22 27 1 0
27 28 1 0
24 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 1 0
34 36 1 0
36 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 612.16Molecular Weight (Monoisotopic): 611.2082AlogP: 6.19#Rotatable Bonds: 12Polar Surface Area: 133.65Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.67CX Basic pKa: 8.17CX LogP: 3.86CX LogD: 3.15Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -1.63
References 1. Guo M,Zuo D,Zhao T,Li X,Cao J,Qiu Y,Wei S,Zhai X. (2021) Structure-based optimization identified novel furyl-containing 2,4-diarylaminopyrimidine analogues as ALK/ROS1 dual inhibitors with anti-mutation effects., 214 [PMID:33581554 ] [10.1016/j.ejmech.2021.113259 ]