The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl)-4-oxo-2-(3-phenylpropanamido)-4-(pyrrolidin-1-yl)butanamide ID: ALA4744524
PubChem CID: 123132928
Max Phase: Preclinical
Molecular Formula: C32H38N4O5
Molecular Weight: 558.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC[C@H](NC(=O)[C@H](CC(=O)N1CCCC1)NC(=O)CCc1ccccc1)C(=O)NCc1cccc2ccccc12
Standard InChI: InChI=1S/C32H38N4O5/c1-41-22-28(31(39)33-21-25-14-9-13-24-12-5-6-15-26(24)25)35-32(40)27(20-30(38)36-18-7-8-19-36)34-29(37)17-16-23-10-3-2-4-11-23/h2-6,9-15,27-28H,7-8,16-22H2,1H3,(H,33,39)(H,34,37)(H,35,40)/t27-,28-/m0/s1
Standard InChI Key: ZDMOOGOWOLJYSG-NSOVKSMOSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
4.0876 -14.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8002 -14.0629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5126 -14.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2252 -14.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9377 -14.4670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6502 -14.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3627 -14.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0753 -14.0504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7878 -14.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5003 -14.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5145 -15.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2234 -13.2337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3645 -15.2879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6484 -13.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3726 -14.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0886 -15.3005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6586 -14.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9437 -14.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9474 -13.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2332 -12.8303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5182 -13.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5219 -14.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2366 -14.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9248 -13.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2063 -12.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4973 -13.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9316 -14.0436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2145 -14.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2139 -15.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9296 -15.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6474 -15.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6444 -14.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2298 -15.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2317 -16.5323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9434 -15.2931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3620 -12.8155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3602 -11.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5691 -17.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8257 -17.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6508 -17.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9039 -17.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
3 11 1 6
4 12 2 0
7 13 2 0
6 14 1 1
1 15 1 0
1 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
10 28 2 0
27 24 2 0
24 25 1 0
25 26 2 0
26 10 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
11 33 1 0
33 34 1 0
33 35 2 0
14 36 1 0
36 37 1 0
34 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.68Molecular Weight (Monoisotopic): 558.2842AlogP: 2.72#Rotatable Bonds: 13Polar Surface Area: 116.84Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.13CX Basic pKa: ┄CX LogP: 2.11CX LogD: 2.11Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -0.61
References 1. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G. (2020) Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides., 63 (21): [PMID:33095579 ] [10.1021/acs.jmedchem.0c01520 ]