(S)-N-((S)-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl)-4-oxo-2-(3-phenylpropanamido)-4-(pyrrolidin-1-yl)butanamide

ID: ALA4744524

PubChem CID: 123132928

Max Phase: Preclinical

Molecular Formula: C32H38N4O5

Molecular Weight: 558.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC[C@H](NC(=O)[C@H](CC(=O)N1CCCC1)NC(=O)CCc1ccccc1)C(=O)NCc1cccc2ccccc12

Standard InChI:  InChI=1S/C32H38N4O5/c1-41-22-28(31(39)33-21-25-14-9-13-24-12-5-6-15-26(24)25)35-32(40)27(20-30(38)36-18-7-8-19-36)34-29(37)17-16-23-10-3-2-4-11-23/h2-6,9-15,27-28H,7-8,16-22H2,1H3,(H,33,39)(H,34,37)(H,35,40)/t27-,28-/m0/s1

Standard InChI Key:  ZDMOOGOWOLJYSG-NSOVKSMOSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
    4.0876  -14.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8002  -14.0629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5126  -14.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2252  -14.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9377  -14.4670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6502  -14.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3627  -14.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0753  -14.0504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7878  -14.4588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5003  -14.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5145  -15.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2234  -13.2337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3645  -15.2879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6484  -13.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3726  -14.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0886  -15.3005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6586  -14.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9437  -14.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9474  -13.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2332  -12.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5182  -13.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5219  -14.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2366  -14.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9248  -13.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2063  -12.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4973  -13.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9316  -14.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2145  -14.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2139  -15.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9296  -15.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6474  -15.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6444  -14.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2298  -15.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2317  -16.5323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9434  -15.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3620  -12.8155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3602  -11.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5691  -17.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8257  -17.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6508  -17.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9039  -17.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  1  6
  4 12  2  0
  7 13  2  0
  6 14  1  1
  1 15  1  0
  1 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 10 28  2  0
 27 24  2  0
 24 25  1  0
 25 26  2  0
 26 10  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 11 33  1  0
 33 34  1  0
 33 35  2  0
 14 36  1  0
 36 37  1  0
 34 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744524

    ---

Associated Targets(Human)

PSMB8 Tclin Proteasome subunit beta type-8 (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 558.68Molecular Weight (Monoisotopic): 558.2842AlogP: 2.72#Rotatable Bonds: 13
Polar Surface Area: 116.84Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.13CX Basic pKa: CX LogP: 2.11CX LogD: 2.11
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -0.61

References

1. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G.  (2020)  Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides.,  63  (21): [PMID:33095579] [10.1021/acs.jmedchem.0c01520]

Source