2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]-N-[(4-methylphenyl)methylbenzamide

ID: ALA4744541

PubChem CID: 146660841

Max Phase: Preclinical

Molecular Formula: C23H23N3O5S

Molecular Weight: 453.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(CNC(=O)c2ccccc2S(=O)(=O)NCC(=O)Nc2ccc(O)cc2)cc1

Standard InChI:  InChI=1S/C23H23N3O5S/c1-16-6-8-17(9-7-16)14-24-23(29)20-4-2-3-5-21(20)32(30,31)25-15-22(28)26-18-10-12-19(27)13-11-18/h2-13,25,27H,14-15H2,1H3,(H,24,29)(H,26,28)

Standard InChI Key:  PLJCMNNMJCVUGW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    7.4244   -6.9829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8955   -6.3057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0720   -6.2353    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9319   -6.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9307   -7.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6455   -7.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3620   -7.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3592   -6.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6437   -6.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6413   -5.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3545   -5.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9256   -5.0060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0689   -5.4103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7818   -4.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4978   -5.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5009   -6.2299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2107   -4.9897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9268   -5.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9253   -6.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6405   -6.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3543   -6.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3486   -5.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6328   -4.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0709   -6.6253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9231   -4.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2074   -3.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2068   -2.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4919   -2.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7778   -2.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7829   -3.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4983   -4.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0615   -2.5435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744541

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.52Molecular Weight (Monoisotopic): 453.1358AlogP: 2.55#Rotatable Bonds: 8
Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 2.72CX LogD: 2.72
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.60

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source