[[(E)-5-Hydroxy-4-methylpent-3-enyl]-(2-oxochromen-7-yl)oxyphosphoryl]oxymethyl 2,2-dimethylpropanoate

ID: ALA4744593

PubChem CID: 162649046

Max Phase: Preclinical

Molecular Formula: C21H27O8P

Molecular Weight: 438.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\CCP(=O)(OCOC(=O)C(C)(C)C)Oc1ccc2ccc(=O)oc2c1)CO

Standard InChI:  InChI=1S/C21H27O8P/c1-15(13-22)6-5-11-30(25,27-14-26-20(24)21(2,3)4)29-17-9-7-16-8-10-19(23)28-18(16)12-17/h6-10,12,22H,5,11,13-14H2,1-4H3/b15-6+

Standard InChI Key:  ZOQVDZUQSCQTBB-GIDUJCDVSA-N

Molfile:  

 
     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   29.8976   -4.6349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3104   -5.3448    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   30.7188   -4.6324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7733   -5.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4810   -5.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1887   -5.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7733   -6.5747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4810   -4.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8965   -5.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6042   -5.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0196   -5.7575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5360   -4.6299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3041   -3.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8934   -3.2195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2998   -2.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8891   -1.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1170   -2.5080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2955   -1.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0719   -1.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4725   -1.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9434   -5.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7519   -3.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9369   -3.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1671   -4.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7610   -5.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1698   -6.0337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9845   -6.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3888   -5.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9776   -4.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3966   -6.7369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  2  0
  4  7  1  0
  5  8  1  0
  6  9  1  0
  9 10  1  0
 10  2  1  0
  2 11  2  0
  3 12  1  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 16 20  1  0
 12 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 12  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4744593

    ---

Associated Targets(Human)

BTN3A1 Tchem Butyrophilin subfamily 3 member A1 (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.41Molecular Weight (Monoisotopic): 438.1444AlogP: 4.26#Rotatable Bonds: 9
Polar Surface Area: 112.27Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.35CX LogD: 3.35
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.20Np Likeness Score: 1.03

References

1. Lentini NA,Schroeder CM,Harmon NM,Huang X,Schladetsch MA,Foust BJ,Poe MM,Hsiao CC,Wiemer AJ,Wiemer DF.  (2021)  Synthesis and Metabolism of BTN3A1 Ligands: Studies on Modifications of the Allylic Alcohol.,  12  (1): [PMID:33488975] [10.1021/acsmedchemlett.0c00586]

Source