1-(5-(3-(5-((5-tert-butyloxazol-2-yl)methylthio)thiazol-2-ylamino)piperidin-1-ylsulfonyl)indolin-1-yl)prop-2-en-1-one

ID: ALA4744627

PubChem CID: 137358312

Max Phase: Preclinical

Molecular Formula: C27H33N5O4S3

Molecular Weight: 587.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1CCc2cc(S(=O)(=O)N3CCCC(Nc4ncc(SCc5ncc(C(C)(C)C)o5)s4)C3)ccc21

Standard InChI:  InChI=1S/C27H33N5O4S3/c1-5-24(33)32-12-10-18-13-20(8-9-21(18)32)39(34,35)31-11-6-7-19(16-31)30-26-29-15-25(38-26)37-17-23-28-14-22(36-23)27(2,3)4/h5,8-9,13-15,19H,1,6-7,10-12,16-17H2,2-4H3,(H,29,30)

Standard InChI Key:  ZQNYFQLNCVPOKT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    6.4632  -15.4689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0588  -16.1787    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.8758  -16.1741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4724  -18.6252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1786  -18.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9240  -18.5419    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.4685  -17.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0572  -17.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2586  -17.3994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2793  -18.0115    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.6131  -18.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4259  -18.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7631  -18.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7650  -17.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0599  -16.9972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3513  -17.4050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3524  -18.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621  -18.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -15.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3548  -14.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9419  -15.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6493  -16.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8364  -19.5471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6355  -19.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7198  -18.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9728  -18.2320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2435  -19.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0747  -20.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8180  -19.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0285  -20.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9392  -14.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6491  -14.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4747  -13.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6569  -13.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3261  -14.4054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5275  -14.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9780  -13.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2785  -15.3572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1794  -14.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  1  0
  7 10  1  0
 11 12  1  0
 13  4  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  2 19  1  0
 15  2  1  0
 19 20  2  0
 20 32  1  0
 31 21  1  0
 21 22  2  0
 22 19  1  0
 12 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 12  2  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
 35 36  1  0
 36 37  1  0
 36 38  2  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4744627

    ---

Associated Targets(Human)

CDK2 Tchem Cyclin-dependent kinase 2 (9050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK7 Tchem Cyclin-dependent kinase 7 (1512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.79Molecular Weight (Monoisotopic): 587.1695AlogP: 5.06#Rotatable Bonds: 8
Polar Surface Area: 108.64Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 3.26CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.77

References

1.  (2020)  Inhibitors of cyclin-dependent kinases, 

Source