N-(4-amino-3-(trifluoromethyl)phenyl)-4-methylbenzenesulfonamide

ID: ALA4744629

PubChem CID: 16777240

Max Phase: Preclinical

Molecular Formula: C14H13F3N2O2S

Molecular Weight: 330.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)Nc2ccc(N)c(C(F)(F)F)c2)cc1

Standard InChI:  InChI=1S/C14H13F3N2O2S/c1-9-2-5-11(6-3-9)22(20,21)19-10-4-7-13(18)12(8-10)14(15,16)17/h2-8,19H,18H2,1H3

Standard InChI Key:  YWTBWBHMWBIXEQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   24.4992  -10.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0948   -9.4802    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.6858  -10.1834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5131   -9.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5120  -10.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2200  -10.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9297  -10.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9268   -9.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2182   -9.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8053   -9.0718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3899   -9.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3933   -8.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6864   -7.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9778   -8.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9806   -9.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6881   -9.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6380  -10.7068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2198  -11.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5120  -11.9343    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.9274  -11.9347    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.2120  -12.3404    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.2694   -7.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 17  1  0
  6 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 14 22  1  0
M  END

Associated Targets(Human)

FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.33Molecular Weight (Monoisotopic): 330.0650AlogP: 3.40#Rotatable Bonds: 3
Polar Surface Area: 72.19Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.44CX Basic pKa: 2.35CX LogP: 3.02CX LogD: 2.99
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.85Np Likeness Score: -1.69

References

1. Xu F,Zhao Y,Zhou H,Li C,Zhang X,Hou T,Qu L,Wei L,Wang J,Liu Y,Liang X.  (2020)  Synthesis and evaluation of 3-(4-(phenoxymethyl)phenyl)propanoic acid and N-phenylbenzenesulfonamide derivatives as FFA4 agonists.,  30  (24): [PMID:33127539] [10.1016/j.bmcl.2020.127650]

Source