The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-(4-(trifluoromethoxy)benzyl)thiazole-4-carboxamide ID: ALA4744633
PubChem CID: 155755073
Max Phase: Preclinical
Molecular Formula: C19H15F5N4O3S
Molecular Weight: 474.41
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#C[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)c1csc(Cc2ccc(OC(F)(F)F)cc2)n1
Standard InChI: InChI=1S/C19H15F5N4O3S/c20-18(21)6-12(7-25)28(10-18)16(29)8-26-17(30)14-9-32-15(27-14)5-11-1-3-13(4-2-11)31-19(22,23)24/h1-4,9,12H,5-6,8,10H2,(H,26,30)/t12-/m0/s1
Standard InChI Key: WYBXEQQFDLJIFJ-LBPRGKRZSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
18.0271 -10.0190 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.4179 -10.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8521 -10.0442 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6662 -12.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1015 -12.0372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9218 -11.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1190 -11.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7877 -11.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4525 -12.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9833 -13.2423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8417 -12.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0556 -13.4655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4065 -13.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5819 -13.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1466 -14.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1925 -12.6587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3244 -14.1502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1271 -14.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8281 -15.3865 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.4585 -14.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3631 -15.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2505 -16.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4845 -16.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3718 -17.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0238 -17.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7907 -17.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8999 -16.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9123 -18.5296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1487 -18.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0372 -19.6594 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4964 -18.3366 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4295 -19.2465 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 2 1 0
2 8 1 0
8 5 1 0
6 9 1 1
9 10 3 0
4 11 1 0
4 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 15 2 0
18 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.41Molecular Weight (Monoisotopic): 474.0785AlogP: 3.12#Rotatable Bonds: 6Polar Surface Area: 95.32Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.15CX LogD: 3.15Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.33
References 1. Jung HJ,Nam EH,Park JY,Ghosh P,Kim IS. (2021) Identification of BR102910 as a selective fibroblast activation protein (FAP) inhibitor., 37 [PMID:33571650 ] [10.1016/j.bmcl.2021.127846 ]