The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Butyl-5-nitro-6-(4-tosylpiperazin-1-yl)-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA4744657
PubChem CID: 162647922
Max Phase: Preclinical
Molecular Formula: C27H28N4O6S
Molecular Weight: 536.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN1C(=O)c2cccc3c(N4CCN(S(=O)(=O)c5ccc(C)cc5)CC4)c([N+](=O)[O-])cc(c23)C1=O
Standard InChI: InChI=1S/C27H28N4O6S/c1-3-4-12-30-26(32)21-7-5-6-20-24(21)22(27(30)33)17-23(31(34)35)25(20)28-13-15-29(16-14-28)38(36,37)19-10-8-18(2)9-11-19/h5-11,17H,3-4,12-16H2,1-2H3
Standard InChI Key: ZGJPECDRTAYCFH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
46.9060 -18.4322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.6955 -19.2246 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
47.4870 -19.0107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0437 -20.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9985 -19.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6086 -20.0715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.8153 -19.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4317 -19.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0090 -18.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1977 -18.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2380 -20.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8588 -20.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2911 -21.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1024 -21.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4795 -20.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0450 -19.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3989 -17.8770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9731 -17.1795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2158 -17.8570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2480 -19.2704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.6704 -19.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4839 -19.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8812 -19.2411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.4587 -18.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6391 -18.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5695 -18.6578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6604 -21.4849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.1192 -19.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7218 -20.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1421 -21.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9600 -21.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.3559 -20.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9333 -19.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.3819 -22.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7918 -20.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3608 -19.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5475 -19.4322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1140 -18.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 12 1 0
4 6 1 0
7 5 1 0
5 6 1 0
7 11 1 0
7 10 2 0
16 8 1 0
8 9 2 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
17 19 1 0
9 17 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
8 20 1 0
23 2 1 0
5 26 2 0
4 27 2 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
6 35 1 0
35 36 1 0
37 36 1 0
37 38 1 0
M CHG 2 17 1 19 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.61Molecular Weight (Monoisotopic): 536.1730AlogP: 3.96#Rotatable Bonds: 7Polar Surface Area: 121.14Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.48CX LogD: 4.48Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.48
References 1. Liang GB,Wei JH,Jiang H,Huang RZ,Qin JT,Wang HL,Wang HS,Zhang Y. (2021) Design, synthesis and antitumor evaluation of new 1,8-naphthalimide derivatives targeting nuclear DNA., 210 [PMID:33109400 ] [10.1016/j.ejmech.2020.112951 ]