7beta,11alpha-dihydroxyl-3,20-dioxo-30-norlupane-28-oic acid

ID: ALA4744720

PubChem CID: 162648505

Max Phase: Preclinical

Molecular Formula: C29H44O6

Molecular Weight: 488.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](C[C@@H](O)[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5C[C@H](O)[C@]43C)[C@@H]12

Standard InChI:  InChI=1S/C29H44O6/c1-15(30)16-7-10-29(24(34)35)12-11-27(5)17(22(16)29)13-18(31)23-26(4)9-8-20(32)25(2,3)19(26)14-21(33)28(23,27)6/h16-19,21-23,31,33H,7-14H2,1-6H3,(H,34,35)/t16-,17+,18+,19-,21-,22+,23+,26-,27+,28+,29-/m0/s1

Standard InChI Key:  HYYQTUYJNLYRHP-LWNFOWIOSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   42.2133  -15.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5034  -16.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0836  -16.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6413  -14.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9356  -14.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2257  -14.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7935  -15.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0919  -16.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3779  -17.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1213  -13.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3429  -15.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9191  -16.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5158  -16.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6331  -15.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2563  -14.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5158  -14.4618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3779  -15.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7935  -14.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8018  -17.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9302  -13.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5847  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6680  -16.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0611  -14.8952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6680  -16.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8489  -12.2826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2092  -16.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3429  -16.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4993  -15.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0836  -15.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3779  -18.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6639  -17.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9581  -17.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.7758  -13.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9314  -15.3038    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.0836  -17.7471    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.7935  -16.5130    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.2215  -14.0573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.2258  -17.3304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0876  -14.4587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4 14  1  0
  5  6  1  0
  6  1  1  0
  7  2  1  0
  8 19  1  0
  9  8  1  0
 10  5  1  0
  4 11  1  1
 12  1  1  0
 13  2  1  0
 14 12  1  0
 15  4  1  0
 16  6  1  0
 17  3  1  0
 18 16  1  0
 19 13  1  0
 20 10  1  0
 10 21  1  6
 22  9  1  0
 23 11  2  0
 24 17  1  0
 25 21  2  0
  1 26  1  6
 27 11  1  0
  2 28  1  1
  3 29  1  1
 30  9  1  0
 31  9  1  0
 22 32  2  0
 33 21  1  0
  5 34  1  6
  8 35  1  6
  7 36  1  6
  6 37  1  1
  4  5  1  0
 18  7  1  0
 20 15  1  0
  8  3  1  0
 22 24  1  0
 13 38  1  1
 18 39  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4744720

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.67Molecular Weight (Monoisotopic): 488.3138AlogP: 4.25#Rotatable Bonds: 2
Polar Surface Area: 111.90Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.40CX Basic pKa: CX LogP: 3.55CX LogD: 0.66
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: 3.20

References

1. Xu SH,Chen HL,Yang ZL,Lyu LW,Fan Y,Sha M,Zhang J,Xu W,Lin Y.  (2020)  New 30-norlupane derivatives through chemical-microbial semi-synthesis of betulinic acid and their neuroprotective effect.,  30  (17): [PMID:32738992] [10.1016/j.bmcl.2020.127407]

Source