rac-methyl 2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)-3-phenylpropanoate

ID: ALA4744726

PubChem CID: 146503681

Max Phase: Preclinical

Molecular Formula: C23H26N2O3

Molecular Weight: 378.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C(Cc1ccccc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C23H26N2O3/c1-28-22(26)20(13-15-7-3-2-4-8-15)24-23(27)25-21-18-11-5-9-16(18)14-17-10-6-12-19(17)21/h2-4,7-8,14,20H,5-6,9-13H2,1H3,(H2,24,25,27)

Standard InChI Key:  INCAQYZCPRUSCC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    2.9609  -26.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3910  -27.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6745  -27.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9601  -27.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3495  -28.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6867  -28.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5055  -28.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1062  -27.8909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8198  -27.4770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5350  -27.8881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8183  -26.6520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6728  -26.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3875  -26.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013  -26.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6658  -25.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8448  -25.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2487  -27.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9639  -27.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6775  -27.4715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9655  -28.7104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3928  -27.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2472  -26.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9608  -26.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6769  -26.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3900  -26.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3889  -25.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6686  -24.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9585  -25.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 17 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744726

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.47Molecular Weight (Monoisotopic): 378.1943AlogP: 3.57#Rotatable Bonds: 5
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: CX LogP: 4.97CX LogD: 4.97
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: -0.43

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source