N-(2-((Bis(4-fluorophenyl)methyl)thio)ethyl)-1-(4-(trifluoromethyl)benzyl)piperidin-4-amine

ID: ALA4744739

PubChem CID: 142590753

Max Phase: Preclinical

Molecular Formula: C28H29F5N2S

Molecular Weight: 520.61

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  Fc1ccc(C(SCCNC2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)c2ccc(F)cc2)cc1

Standard InChI:  InChI=1S/C28H29F5N2S/c29-24-9-3-21(4-10-24)27(22-5-11-25(30)12-6-22)36-18-15-34-26-13-16-35(17-14-26)19-20-1-7-23(8-2-20)28(31,32)33/h1-12,26-27,34H,13-19H2

Standard InChI Key:  SDISULJMGRDCFH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   33.4539  -17.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4528  -18.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1608  -18.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8705  -18.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8676  -17.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1590  -17.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5788  -18.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5801  -19.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2859  -18.5556    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.9942  -18.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7013  -18.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4096  -18.9609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8717  -20.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8727  -21.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5815  -21.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2909  -21.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2865  -20.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7461  -17.3304    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.5839  -22.2326    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.1167  -18.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8251  -18.9587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1154  -17.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8225  -17.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5308  -17.7318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2379  -17.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5321  -18.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9463  -17.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9436  -18.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6511  -18.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3591  -18.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3552  -17.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6471  -17.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0680  -18.9489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0704  -19.7661    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   44.7745  -18.5383    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   44.7722  -19.3567    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  8  1  0
  1 18  1  0
 15 19  1  0
 12 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 21 26  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4744739

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 520.61

Molecular Weight (Monoisotopic): 520.1972

AlogP: 7.06

#Rotatable Bonds: 9

Polar Surface Area: 15.27

Molecular Species: BASE

HBA: 3

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 2

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 9.95

CX LogP: 6.82

CX LogD: 4.26

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.24

Np Likeness Score: -1.12

References

1. Giancola JB,Bonifazi A,Cao J,Ku T,Haraczy AJ,Lam J,Rais R,Coggiano MA,Tanda G,Newman AH.  (2020)  Structure-activity relationships for a series of (Bis(4-fluorophenyl)methyl)sulfinylethyl-aminopiperidines and -piperidine amines at the dopamine transporter: Bioisosteric replacement of the piperazine improves metabolic stability.,  208  [PMID:32947229] [10.1016/j.ejmech.2020.112674]

Source

Source(1):

• Scientific Literature