The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((Bis(4-fluorophenyl)methyl)thio)ethyl)-1-(4-(trifluoromethyl)benzyl)piperidin-4-amine ID: ALA4744739
PubChem CID: 142590753
Max Phase: Preclinical
Molecular Formula: C28H29F5N2S
Molecular Weight: 520.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(C(SCCNC2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C28H29F5N2S/c29-24-9-3-21(4-10-24)27(22-5-11-25(30)12-6-22)36-18-15-34-26-13-16-35(17-14-26)19-20-1-7-23(8-2-20)28(31,32)33/h1-12,26-27,34H,13-19H2
Standard InChI Key: SDISULJMGRDCFH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
33.4539 -17.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4528 -18.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1608 -18.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8705 -18.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8676 -17.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1590 -17.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5788 -18.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5801 -19.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2859 -18.5556 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.9942 -18.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7013 -18.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4096 -18.9609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8717 -20.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8727 -21.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5815 -21.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2909 -21.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2865 -20.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7461 -17.3304 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.5839 -22.2326 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.1167 -18.5512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8251 -18.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1154 -17.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8225 -17.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5308 -17.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2379 -17.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5321 -18.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9463 -17.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9436 -18.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6511 -18.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3591 -18.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3552 -17.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6471 -17.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0680 -18.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0704 -19.7661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.7745 -18.5383 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.7722 -19.3567 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
8 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 8 1 0
1 18 1 0
15 19 1 0
12 20 1 0
20 21 1 0
20 22 1 0
22 23 1 0
21 26 1 0
23 24 1 0
24 25 1 0
24 26 1 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.61Molecular Weight (Monoisotopic): 520.1972AlogP: 7.06#Rotatable Bonds: 9Polar Surface Area: 15.27Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.95CX LogP: 6.82CX LogD: 4.26Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.12
References 1. Giancola JB,Bonifazi A,Cao J,Ku T,Haraczy AJ,Lam J,Rais R,Coggiano MA,Tanda G,Newman AH. (2020) Structure-activity relationships for a series of (Bis(4-fluorophenyl)methyl)sulfinylethyl-aminopiperidines and -piperidine amines at the dopamine transporter: Bioisosteric replacement of the piperazine improves metabolic stability., 208 [PMID:32947229 ] [10.1016/j.ejmech.2020.112674 ]