The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4'-(1-((5-cyclopropyl-1H-pyrazol-3-yl)amino)-1-oxopropan-2-yl)-[1,1'-biphenyl]-4-yl)-4-morpholinobut-2-enamide ID: ALA4744778
PubChem CID: 155175708
Max Phase: Preclinical
Molecular Formula: C29H33N5O3
Molecular Weight: 499.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)Nc1cc(C2CC2)[nH]n1)c1ccc(-c2ccc(NC(=O)/C=C/CN3CCOCC3)cc2)cc1
Standard InChI: InChI=1S/C29H33N5O3/c1-20(29(36)31-27-19-26(32-33-27)24-8-9-24)21-4-6-22(7-5-21)23-10-12-25(13-11-23)30-28(35)3-2-14-34-15-17-37-18-16-34/h2-7,10-13,19-20,24H,8-9,14-18H2,1H3,(H,30,35)(H2,31,32,33,36)/b3-2+
Standard InChI Key: UDSBONMBGXRFLA-NSCUHMNNSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
9.8437 -9.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5517 -9.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2559 -9.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2559 -10.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5542 -10.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8437 -10.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1315 -10.7169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4234 -10.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7154 -10.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0073 -10.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2951 -10.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5870 -10.3051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8790 -10.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1709 -10.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1709 -9.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8790 -9.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5870 -9.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4234 -9.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9681 -9.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9684 -8.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6740 -7.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3823 -8.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3846 -9.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6805 -9.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0904 -7.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0904 -7.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8026 -8.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8026 -9.0755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5107 -7.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2187 -8.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9309 -7.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5442 -8.4152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2156 -9.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3976 -9.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6232 -9.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6232 -10.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3348 -10.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
13 12 1 0
14 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 17 1 0
8 18 2 0
19 3 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
22 25 1 0
25 26 1 0
25 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
31 30 2 0
31 32 1 0
32 33 1 0
34 33 2 0
30 34 1 0
35 33 1 0
35 36 1 0
36 37 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.62Molecular Weight (Monoisotopic): 499.2583AlogP: 4.52#Rotatable Bonds: 9Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.26CX Basic pKa: 6.39CX LogP: 4.35CX LogD: 4.31Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -1.18
References 1. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 2. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 3. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 4. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 5. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors,