(E)-N-(4'-(1-((5-cyclopropyl-1H-pyrazol-3-yl)amino)-1-oxopropan-2-yl)-[1,1'-biphenyl]-4-yl)-4-morpholinobut-2-enamide

ID: ALA4744778

PubChem CID: 155175708

Max Phase: Preclinical

Molecular Formula: C29H33N5O3

Molecular Weight: 499.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C(=O)Nc1cc(C2CC2)[nH]n1)c1ccc(-c2ccc(NC(=O)/C=C/CN3CCOCC3)cc2)cc1

Standard InChI:  InChI=1S/C29H33N5O3/c1-20(29(36)31-27-19-26(32-33-27)24-8-9-24)21-4-6-22(7-5-21)23-10-12-25(13-11-23)30-28(35)3-2-14-34-15-17-37-18-16-34/h2-7,10-13,19-20,24H,8-9,14-18H2,1H3,(H,30,35)(H2,31,32,33,36)/b3-2+

Standard InChI Key:  UDSBONMBGXRFLA-NSCUHMNNSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    9.8437   -9.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5517   -9.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2559   -9.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2559  -10.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5542  -10.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8437  -10.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1315  -10.7169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4234  -10.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7154  -10.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0073  -10.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2951  -10.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5870  -10.3051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8790  -10.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1709  -10.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1709   -9.4856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8790   -9.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5870   -9.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4234   -9.4856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9681   -9.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9684   -8.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6740   -7.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3823   -8.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3846   -9.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6805   -9.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0904   -7.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0904   -7.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8026   -8.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8026   -9.0755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5107   -7.8484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2187   -8.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9309   -7.8484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5442   -8.4152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2156   -9.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3976   -9.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6232   -9.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6232  -10.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3348  -10.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 13 12  1  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 12 17  1  0
  8 18  2  0
 19  3  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 31 30  2  0
 31 32  1  0
 32 33  1  0
 34 33  2  0
 30 34  1  0
 35 33  1  0
 35 36  1  0
 36 37  1  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744778

    ---

Associated Targets(Human)

CDK12 Tchem Cyclin-dependent kinase 12 (438 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK13 Tchem Cyclin-dependent kinase 13 (570 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK7 Tchem Cyclin-dependent kinase 7 (1512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.62Molecular Weight (Monoisotopic): 499.2583AlogP: 4.52#Rotatable Bonds: 9
Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.26CX Basic pKa: 6.39CX LogP: 4.35CX LogD: 4.31
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -1.18

References

1.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 
2.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 
3.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 
4.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 
5.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 

Source