The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(9-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-9H-carbazol-2-yl)vinyl)-1-methylquinolinium iodide ID: ALA4744803
PubChem CID: 162647928
Max Phase: Preclinical
Molecular Formula: C31H33IN2O3
Molecular Weight: 481.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOCCOCCn1c2ccccc2c2ccc(/C=C/c3ccc4ccccc4[n+]3C)cc21.[I-]
Standard InChI: InChI=1S/C31H33N2O3.HI/c1-32-26(15-13-25-7-3-5-9-29(25)32)14-11-24-12-16-28-27-8-4-6-10-30(27)33(31(28)23-24)17-18-35-21-22-36-20-19-34-2;/h3-16,23H,17-22H2,1-2H3;1H/q+1;/p-1
Standard InChI Key: WQJVFAIVAXFZMQ-UHFFFAOYSA-M
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
15.7911 -9.7122 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
7.3066 -9.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3055 -10.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0202 -11.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0185 -9.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7338 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7387 -10.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5182 -9.5777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0080 -10.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5231 -10.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8598 -11.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6814 -11.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1650 -11.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8255 -10.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9859 -11.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3260 -11.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1469 -11.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4825 -12.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3026 -12.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6209 -11.3201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4401 -11.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7842 -12.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6073 -12.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0874 -11.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7384 -10.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9162 -10.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2771 -10.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7686 -8.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5745 -8.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8248 -7.8293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6307 -7.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8811 -6.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6870 -6.6908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9374 -5.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7433 -5.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9935 -4.9423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7995 -4.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 10 1 0
9 8 1 0
8 6 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 22 2 0
21 20 2 0
20 17 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
20 27 1 0
8 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
M CHG 2 1 -1 20 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.62Molecular Weight (Monoisotopic): 481.2486AlogP: 5.62#Rotatable Bonds: 11Polar Surface Area: 36.50Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.14CX LogD: 1.14Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: -0.40
References 1. Yu QQ,Wang MQ. (2020) Carbazole-based fluorescent probes for G-quadruplex DNA targeting with superior selectivity and low cytotoxicity., 28 (17): [PMID:32773092 ] [10.1016/j.bmc.2020.115641 ]