2-(2-(9-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-9H-carbazol-2-yl)vinyl)-1-methylquinolinium iodide

ID: ALA4744803

PubChem CID: 162647928

Max Phase: Preclinical

Molecular Formula: C31H33IN2O3

Molecular Weight: 481.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCOCCOCCn1c2ccccc2c2ccc(/C=C/c3ccc4ccccc4[n+]3C)cc21.[I-]

Standard InChI:  InChI=1S/C31H33N2O3.HI/c1-32-26(15-13-25-7-3-5-9-29(25)32)14-11-24-12-16-28-27-8-4-6-10-30(27)33(31(28)23-24)17-18-35-21-22-36-20-19-34-2;/h3-16,23H,17-22H2,1-2H3;1H/q+1;/p-1

Standard InChI Key:  WQJVFAIVAXFZMQ-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   15.7911   -9.7122    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    7.3066   -9.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3055  -10.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0202  -11.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0185   -9.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7338   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7387  -10.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5182   -9.5777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0080  -10.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5231  -10.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8598  -11.6644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6814  -11.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1650  -11.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8255  -10.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9859  -11.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3260  -11.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1469  -11.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4825  -12.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3026  -12.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6209  -11.3201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4401  -11.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7842  -12.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6073  -12.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0874  -11.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7384  -10.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9162  -10.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2771  -10.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7686   -8.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5745   -8.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8248   -7.8293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6307   -7.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8811   -6.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6870   -6.6908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9374   -5.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7433   -5.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9935   -4.9423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7995   -4.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  8  6  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 22  2  0
 21 20  2  0
 20 17  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 20 27  1  0
  8 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  CHG  2   1  -1  20   1
M  END

Associated Targets(Human)

quadruplex DNA (2700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.62Molecular Weight (Monoisotopic): 481.2486AlogP: 5.62#Rotatable Bonds: 11
Polar Surface Area: 36.50Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 1.14CX LogD: 1.14
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: -0.40

References

1. Yu QQ,Wang MQ.  (2020)  Carbazole-based fluorescent probes for G-quadruplex DNA targeting with superior selectivity and low cytotoxicity.,  28  (17): [PMID:32773092] [10.1016/j.bmc.2020.115641]

Source