The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]phenyl]cyclohexanecarboxamide ID: ALA4744828
PubChem CID: 162648364
Max Phase: Preclinical
Molecular Formula: C23H26N4O2
Molecular Weight: 390.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(CCNc2n[nH]c(=O)c3ccccc23)cc1)C1CCCCC1
Standard InChI: InChI=1S/C23H26N4O2/c28-22(17-6-2-1-3-7-17)25-18-12-10-16(11-13-18)14-15-24-21-19-8-4-5-9-20(19)23(29)27-26-21/h4-5,8-13,17H,1-3,6-7,14-15H2,(H,24,26)(H,25,28)(H,27,29)
Standard InChI Key: LEHQLXHISVZEME-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
3.7924 -7.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5019 -6.8429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5019 -6.0216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7924 -5.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7924 -8.0687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7924 -4.7835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5043 -4.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0872 -6.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0897 -6.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3824 -5.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6721 -6.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6735 -6.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3814 -7.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2110 -4.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9197 -4.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6222 -4.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3305 -4.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3330 -3.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6213 -3.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9160 -3.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0412 -3.1591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7484 -3.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7474 -4.3857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4566 -3.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1637 -3.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8698 -3.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8750 -2.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1679 -1.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4557 -2.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 4 1 0
8 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
1 5 2 0
4 6 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.49Molecular Weight (Monoisotopic): 390.2056AlogP: 4.10#Rotatable Bonds: 6Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.87CX Basic pKa: 3.69CX LogP: 3.83CX LogD: 3.83Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.42
References 1. Zhang XJ,Xu Y,Mou HX,Wang S,Hao SY,Chen SW. (2020) The synthesis and anti-tumour properties of novel 4-substituted phthalazinones as Aurora B kinase inhibitors., 30 (23.0): [PMID:32941989 ] [10.1016/j.bmcl.2020.127556 ]