3-Chloro-2-hydroxy-5-(indoline-1-carbonyl)benzonitrile

ID: ALA4744854

PubChem CID: 162648607

Max Phase: Preclinical

Molecular Formula: C16H11ClN2O2

Molecular Weight: 298.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cc(C(=O)N2CCc3ccccc32)cc(Cl)c1O

Standard InChI:  InChI=1S/C16H11ClN2O2/c17-13-8-11(7-12(9-18)15(13)20)16(21)19-6-5-10-3-1-2-4-14(10)19/h1-4,7-8,20H,5-6H2

Standard InChI Key:  KPGACRWGWQVLCF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   15.7728  -17.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7717  -18.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4797  -18.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4780  -16.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1866  -17.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1868  -18.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9655  -18.4434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4465  -17.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9651  -17.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2182  -19.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6716  -19.8279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0176  -19.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2686  -20.1685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0671  -20.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6147  -19.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3581  -18.9503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5601  -18.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4143  -19.8992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9013  -18.3432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4458  -17.7338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3195  -21.1156    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  7 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 19 20  3  0
 16 19  1  0
 14 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744854

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 298.73Molecular Weight (Monoisotopic): 298.0509AlogP: 3.12#Rotatable Bonds: 1
Polar Surface Area: 64.33Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 5.80CX Basic pKa: CX LogP: 3.13CX LogD: 1.66
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.88Np Likeness Score: -1.55

References

1. Uda J,Kobashi S,Miyata S,Ashizawa N,Matsumoto K,Iwanaga T.  (2020)  Discovery of Dotinurad (FYU-981), a New Phenol Derivative with Highly Potent Uric Acid Lowering Activity.,  11  (10): [PMID:33062187] [10.1021/acsmedchemlett.0c00176]

Source