The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(4-(3-((5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl)amino)piperidin-1-yl)phenyl)acrylamide ID: ALA4744880
PubChem CID: 134543980
Max Phase: Preclinical
Molecular Formula: C26H25ClN6O
Molecular Weight: 472.98
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccc(N2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)cc1
Standard InChI: InChI=1S/C26H25ClN6O/c1-2-24(34)30-17-9-11-19(12-10-17)33-13-5-6-18(16-33)31-26-29-15-22(27)25(32-26)21-14-28-23-8-4-3-7-20(21)23/h2-4,7-12,14-15,18,28H,1,5-6,13,16H2,(H,30,34)(H,29,31,32)/t18-/m1/s1
Standard InChI Key: AVAYAPINYJTPQZ-GOSISDBHSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
7.0174 -7.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7303 -6.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4434 -7.1712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4434 -7.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7328 -8.4056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0174 -8.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3045 -8.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3045 -9.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5011 -9.4862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0284 -8.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5232 -8.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1879 -7.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3643 -7.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8793 -7.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2086 -8.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1563 -8.4068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8692 -7.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8692 -7.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5863 -6.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2991 -7.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2992 -7.9963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5863 -8.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0120 -8.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7294 -7.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4424 -8.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4401 -9.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1531 -9.6436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8660 -9.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8660 -8.4039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5788 -9.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2959 -9.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7270 -9.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0124 -9.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3045 -6.7572 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
7 6 1 0
7 8 2 0
8 9 1 0
9 10 1 0
11 10 2 0
7 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
10 15 1 0
4 16 1 0
17 16 1 6
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
17 22 1 0
21 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 2 0
26 32 2 0
32 33 1 0
33 23 2 0
1 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.98Molecular Weight (Monoisotopic): 472.1778AlogP: 5.48#Rotatable Bonds: 6Polar Surface Area: 85.94Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.95CX LogP: 5.31CX LogD: 5.31Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.23
References 1. (2020) Inhibitors of cyclin-dependent kinase 12 (cdk12) and uses thereof,