5-[2-(dimethylamino)ethyl]-11,12-dihydrobenzo[c][1]benzazocin-6-one

ID: ALA4744893

PubChem CID: 162647537

Max Phase: Preclinical

Molecular Formula: C19H22N2O

Molecular Weight: 294.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCN1C(=O)c2ccccc2CCc2ccccc21

Standard InChI:  InChI=1S/C19H22N2O/c1-20(2)13-14-21-18-10-6-4-8-16(18)12-11-15-7-3-5-9-17(15)19(21)22/h3-10H,11-14H2,1-2H3

Standard InChI Key:  BTCYIPDQTUQALX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   21.4313   -2.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4301   -3.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1382   -4.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1364   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2541   -4.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4355   -4.1790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8518   -3.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8450   -2.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4190   -2.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2377   -2.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8197   -2.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8282   -3.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5407   -3.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2452   -3.5714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2328   -2.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5197   -2.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5732   -4.9246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0217   -4.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2045   -4.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7902   -5.5802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9730   -5.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1930   -6.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  7  2  0
  8  4  2  0
  4  1  1  0
 12  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 17  2  0
  6 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744893

    ---

Associated Targets(Human)

SLC6A4 Tclin Serotonin transporter (12625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HRH1 Tclin Histamine H1 receptor (7573 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 294.40Molecular Weight (Monoisotopic): 294.1732AlogP: 2.99#Rotatable Bonds: 3
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.23CX LogP: 3.51CX LogD: 2.62
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.87Np Likeness Score: -0.88

References

1. Bieszczad B,Siwek A,Wilczek M,Trzybiński D,Woźniak K,Satała G,Bojarski AJ,Mieczkowski A.  (2020)  Synthesis, crystal structure and biological activity of novel analogues of tricyclic drugs.,  30  (21.0): [PMID:32798652] [10.1016/j.bmcl.2020.127493]

Source