The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)propyl)-4,9-dioxo-4,9-dihydronaphtho[2,3-b]furan-2-carboxamide ID: ALA4744979
PubChem CID: 162648525
Max Phase: Preclinical
Molecular Formula: C29H22N4O8
Molecular Weight: 554.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CCC(N2C(=O)c3cccc(NCCCNC(=O)c4cc5c(o4)C(=O)c4ccccc4C5=O)c3C2=O)C(=O)N1
Standard InChI: InChI=1S/C29H22N4O8/c34-21-10-9-19(26(37)32-21)33-28(39)16-7-3-8-18(22(16)29(33)40)30-11-4-12-31-27(38)20-13-17-23(35)14-5-1-2-6-15(14)24(36)25(17)41-20/h1-3,5-8,13,19,30H,4,9-12H2,(H,31,38)(H,32,34,37)
Standard InChI Key: WCPIVGVJELBLHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
35.4280 -4.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4280 -3.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7139 -4.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7164 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0039 -3.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2882 -3.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2896 -4.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0028 -4.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1422 -3.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1422 -4.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9253 -4.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4069 -4.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9254 -3.4946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2337 -4.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6493 -4.8780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6493 -3.4449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4266 -2.5054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4296 -5.8127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4761 -3.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8874 -2.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7142 -2.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1297 -2.0117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9565 -2.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6074 -2.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1875 -1.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3628 -1.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1911 -2.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3673 -2.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1141 -3.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7816 -4.0005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.4487 -3.5143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7834 -4.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0651 -5.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0634 -6.0557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7782 -6.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4965 -6.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4999 -5.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3277 -3.7691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2353 -3.7683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.7754 -7.3017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3493 -4.8197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 1 1 0
1 10 1 0
9 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
12 14 1 0
14 15 2 0
14 16 1 0
2 17 2 0
1 18 2 0
16 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 28 2 0
27 24 2 0
24 25 1 0
25 26 2 0
26 23 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
30 32 1 0
29 38 2 0
31 39 2 0
35 40 2 0
33 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.52Molecular Weight (Monoisotopic): 554.1438AlogP: 1.69#Rotatable Bonds: 7Polar Surface Area: 171.96Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.35CX Basic pKa: 2.29CX LogP: 1.00CX LogD: 1.00Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -0.19