Methyl 2-(5-nitro-1-benzofuran-2-amido)benzoate

ID: ALA4745040

PubChem CID: 156285135

Max Phase: Preclinical

Molecular Formula: C17H12N2O6

Molecular Weight: 340.29

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccccc1NC(=O)c1cc2cc([N+](=O)[O-])ccc2o1

Standard InChI:  InChI=1S/C17H12N2O6/c1-24-17(21)12-4-2-3-5-13(12)18-16(20)15-9-10-8-11(19(22)23)6-7-14(10)25-15/h2-9H,1H3,(H,18,20)

Standard InChI Key:  JCTAKIOVKWEFTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    1.7350  -20.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7339  -21.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4482  -21.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4464  -19.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1614  -20.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1662  -21.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9532  -21.3313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4349  -20.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9453  -19.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0201  -19.8465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3062  -20.2589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0199  -19.0221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2593  -20.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6758  -21.3670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6673  -19.9389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4918  -19.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9062  -20.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7299  -20.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1388  -19.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7179  -19.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8956  -19.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4763  -18.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8818  -17.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6518  -18.5173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4628  -17.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 10 12  1  0
  1 10  1  0
  8 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  1  0
 22 24  2  0
 21 22  1  0
 23 25  1  0
M  CHG  2  10   1  12  -1
M  END

Alternative Forms

  1. Parent:

    ALA4745040

    ---

Associated Targets(non-human)

Streptococcus mutans (2687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.29Molecular Weight (Monoisotopic): 340.0695AlogP: 3.38#Rotatable Bonds: 4
Polar Surface Area: 111.68Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.05CX Basic pKa: CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.44Np Likeness Score: -1.43

References

1. Nijampatnam B,Ahirwar P,Pukkanasut P,Womack H,Casals L,Zhang H,Cai X,Michalek SM,Wu H,Velu SE.  (2021)  Discovery of Potent Inhibitors of Streptococcus mutans Biofilm with Antivirulence Activity.,  12  (1): [PMID:33488963] [10.1021/acsmedchemlett.0c00373]

Source