The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(3-(3,4-dihydroisoquinolin-2(1H)-yl)-3-oxoprop-1-en-1-yl)-2-methoxyphenyl diphenylcarbamate ID: ALA4745075
PubChem CID: 162647681
Max Phase: Preclinical
Molecular Formula: C32H28N2O4
Molecular Weight: 504.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)N2CCc3ccccc3C2)ccc1OC(=O)N(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C32H28N2O4/c1-37-30-22-24(17-19-31(35)33-21-20-25-10-8-9-11-26(25)23-33)16-18-29(30)38-32(36)34(27-12-4-2-5-13-27)28-14-6-3-7-15-28/h2-19,22H,20-21,23H2,1H3/b19-17+
Standard InChI Key: AJGKMXXAHDHHEF-HTXNQAPBSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
20.7998 -17.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7987 -18.5955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5108 -19.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2246 -18.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2218 -17.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5091 -17.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9321 -17.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6455 -17.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3558 -17.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0691 -17.7575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3527 -16.5262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0865 -19.0035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3791 -18.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6670 -19.0024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3798 -17.7730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0879 -17.3593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0877 -16.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0699 -18.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7751 -18.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7728 -17.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4866 -17.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4860 -18.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1963 -18.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9078 -18.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9045 -17.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1936 -17.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9606 -18.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6643 -19.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9650 -17.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2595 -17.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5494 -17.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5493 -18.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2554 -18.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9530 -20.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9499 -21.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6568 -21.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3683 -21.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3678 -20.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
1 16 1 0
16 17 1 0
10 18 1 0
10 20 1 0
18 19 1 0
19 22 1 0
21 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
14 27 1 0
14 28 1 0
27 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 27 1 0
28 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.59Molecular Weight (Monoisotopic): 504.2049AlogP: 6.63#Rotatable Bonds: 6Polar Surface Area: 59.08Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.42CX LogD: 6.42Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -0.61
References 1. Sang Z,Wang K,Bai P,Wu A,Shi J,Liu W,Zhu G,Wang Y,Lan Y,Chen Z,Zhao Y,Qiao Z,Wang C,Tan Z. (2020) Design, synthesis and biological evaluation of novel O-carbamoyl ferulamide derivatives as multi-target-directed ligands for the treatment of Alzheimer's disease., 194 [PMID:32240904 ] [10.1016/j.ejmech.2020.112265 ]