(2S,3R,4R,6R)-2-(5-(benzo[b]thiophen-2-ylmethyl)-4-chloro-2-methoxyphenyl)-5,5-difluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4-diol

ID: ALA4745086

PubChem CID: 162647818

Max Phase: Preclinical

Molecular Formula: C22H21ClF2O5S

Molecular Weight: 470.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(Cl)c(Cc2cc3ccccc3s2)cc1[C@@H]1O[C@H](CO)C(F)(F)[C@H](O)[C@H]1O

Standard InChI:  InChI=1S/C22H21ClF2O5S/c1-29-16-9-15(23)12(7-13-6-11-4-2-3-5-17(11)31-13)8-14(16)20-19(27)21(28)22(24,25)18(10-26)30-20/h2-6,8-9,18-21,26-28H,7,10H2,1H3/t18-,19+,20+,21-/m1/s1

Standard InChI Key:  SDJRROXRYCTJJZ-IVAOSVALSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   26.7527   -4.9568    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.1695   -4.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3479   -4.2424    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.1695   -3.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8790   -4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5884   -4.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5884   -3.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8790   -3.0129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2973   -3.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8790   -5.4768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4565   -3.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2955   -4.6607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4541   -2.1978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0004   -3.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7088   -3.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7117   -2.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0002   -1.7991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2947   -2.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4151   -3.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1242   -3.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8671   -3.3675    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.2099   -2.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0098   -2.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4163   -2.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2330   -2.7656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6442   -2.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2327   -1.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4173   -1.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4200   -1.8022    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.5861   -1.8002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5845   -0.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  4  8  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  1
  5 10  1  1
  4 11  1  1
  6 12  1  6
 11 13  1  0
  9 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  9  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 21 24  1  0
 23 22  1  0
 22 20  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 16 29  1  0
 18 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4745086

    ---

Associated Targets(Human)

SLC5A1 Tclin Sodium/glucose cotransporter 1 (1526 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC5A2 Tclin Sodium/glucose cotransporter 2 (2000 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.92Molecular Weight (Monoisotopic): 470.0766AlogP: 3.94#Rotatable Bonds: 5
Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.53CX Basic pKa: CX LogP: 4.09CX LogD: 4.09
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: 0.05

References

1. Xu G,Du F,Kuo GH,Xu JZ,Liang Y,Demarest K,Gaul MD.  (2020)  5,5-Difluoro- and 5-Fluoro-5-methyl-hexose-based C-Glucosides as potent and orally bioavailable SGLT1 and SGLT2 dual inhibitors.,  30  (17): [PMID:32738984] [10.1016/j.bmcl.2020.127387]

Source