(R)-2-(5-(4-((1-(2-Fluoro-5-(pyrrolidin-1-yl)phenyl)ethyl)amino)-quinolin-6-yl)pyrimidin-2-yl)propan-2-ol

ID: ALA4745102

PubChem CID: 162648827

Max Phase: Preclinical

Molecular Formula: C28H30FN5O

Molecular Weight: 471.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](Nc1ccnc2ccc(-c3cnc(C(C)(C)O)nc3)cc12)c1cc(N2CCCC2)ccc1F

Standard InChI:  InChI=1S/C28H30FN5O/c1-18(22-15-21(7-8-24(22)29)34-12-4-5-13-34)33-26-10-11-30-25-9-6-19(14-23(25)26)20-16-31-27(32-17-20)28(2,3)35/h6-11,14-18,35H,4-5,12-13H2,1-3H3,(H,30,33)/t18-/m1/s1

Standard InChI Key:  VDBAXPLWHOAJIG-GOSISDBHSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    7.9779   -8.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5735   -7.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1645   -8.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2850   -6.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2856   -6.1035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9949   -5.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6996   -6.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6991   -6.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9938   -7.3297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5330   -4.4719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2418   -4.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2412   -5.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5319   -6.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8230   -5.6973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1178   -6.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4090   -5.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4095   -4.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1148   -4.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8236   -4.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5313   -6.9235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2401   -7.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9495   -6.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2396   -8.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9484   -8.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9478   -9.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2385   -9.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5297   -9.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5302   -8.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8244   -9.7832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0774   -9.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5291  -10.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9372  -10.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7357  -10.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6536   -8.1507    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8686   -6.9191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 10 19  1  0
 14 19  1  0
 21 22  1  6
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 29 33  1  0
 27 29  1  0
 24 34  1  0
 21 23  1  0
 20 21  1  0
 13 20  1  0
  7 16  1  0
  2  4  1  0
  2 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4745102

    ---

Associated Targets(Human)

TNF Tclin TNF-alpha (1897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.58Molecular Weight (Monoisotopic): 471.2434AlogP: 5.83#Rotatable Bonds: 6
Polar Surface Area: 74.17Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.36CX Basic pKa: 7.98CX LogP: 4.77CX LogD: 4.17
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.10

References

1. Xiao HY,Li N,Duan JJ,Jiang B,Lu Z,Ngu K,Tino J,Kopcho LM,Lu H,Chen J,Tebben AJ,Sheriff S,Chang CY,Yanchunas J,Calambur D,Gao M,Shuster DJ,Susulic V,Xie JH,Guarino VR,Wu DR,Gregor KR,Goldstine CB,Hynes J,Macor JE,Salter-Cid L,Burke JR,Shaw PJ,Dhar TGM.  (2020)  Biologic-like In Vivo Efficacy with Small Molecule Inhibitors of TNFα Identified Using Scaffold Hopping and Structure-Based Drug Design Approaches.,  63  (23): [PMID:33261314] [10.1021/acs.jmedchem.0c01732]

Source