NA

ID: ALA4745109

PubChem CID: 162648832

Max Phase: Preclinical

Molecular Formula: C19H22N2O5S2

Molecular Weight: 422.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS[C@@]12C[C@H]3C(=O)CC[C@H](O)[C@H]3N1C(=O)[C@@]13C[C@@H]4[C@@H]([C@@H](O)C=C[C@@H]4S1)N3C2=O

Standard InChI:  InChI=1S/C19H22N2O5S2/c1-27-18-6-8-10(22)2-3-11(23)14(8)20(18)17(26)19-7-9-13(28-19)5-4-12(24)15(9)21(19)16(18)25/h4-5,8-9,11-15,23-24H,2-3,6-7H2,1H3/t8-,9-,11-,12-,13-,14-,15-,18+,19+/m0/s1

Standard InChI Key:  HOWQTPBIWCZLFU-DMKSIDPTSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   34.9654  -11.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9654   -9.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2766  -10.9289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2721  -10.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5101   -9.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0579   -9.3564    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.2643   -8.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9624   -8.9313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9619  -12.1217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5174  -11.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0426  -10.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2515  -10.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9289  -11.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4037  -11.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2011  -11.9129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6744  -12.5536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9134  -11.8658    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.6500  -10.1323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6472  -10.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4031  -11.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4077   -9.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8674  -10.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6489  -10.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9771   -9.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5174   -9.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7296   -9.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0018   -9.1913    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.0708  -11.3004    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.2652   -8.5237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8108  -10.0003    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.7801   -9.9814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4772   -9.9673    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.0530  -11.1600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 19  1  0
 18  2  1  0
  3  4  1  0
  4  5  1  0
  5 11  1  0
 10  3  1  0
  4  6  1  6
  6  7  1  0
  2  8  2  0
  1  9  2  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  1
 10 17  1  1
 18 19  1  0
 19 20  1  0
 20 22  1  0
 21 18  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 27  1  1
 22 28  1  1
 26 29  1  1
 19 30  1  6
 12 31  2  0
 11 32  1  1
 23 30  1  0
 23 33  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4745109

    ---

Associated Targets(non-human)

Human immunodeficiency virus (3636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.53Molecular Weight (Monoisotopic): 422.0970AlogP: -0.04#Rotatable Bonds: 1
Polar Surface Area: 98.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.29CX LogD: 0.29
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: 2.53

References

1. Zhu M,Zhang X,Huang X,Wang H,Anjum K,Gu Q,Zhu T,Zhang G,Li D.  (2020)  Irregularly Bridged Epipolythiodioxopiperazines and Related Analogues: Sources, Structures, and Biological Activities.,  83  (6): [PMID:32543845] [10.1021/acs.jnatprod.9b01283]

Source