The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,Z)-N-(1-bromo-1-(3-(2-(diethylamino)ethoxy)phenyl)-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-3-oxoprop-1-en-2-yl)benzamide ID: ALA4745160
PubChem CID: 162647943
Max Phase: Preclinical
Molecular Formula: C31H36BrN3O4
Molecular Weight: 594.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCOc1cccc(/C(Br)=C(/NC(=O)c2ccccc2)C(=O)N[C@H](CO)Cc2ccccc2)c1
Standard InChI: InChI=1S/C31H36BrN3O4/c1-3-35(4-2)18-19-39-27-17-11-16-25(21-27)28(32)29(34-30(37)24-14-9-6-10-15-24)31(38)33-26(22-36)20-23-12-7-5-8-13-23/h5-17,21,26,36H,3-4,18-20,22H2,1-2H3,(H,33,38)(H,34,37)/b29-28-/t26-/m0/s1
Standard InChI Key: ISUFNOJOHUTUNL-KVMGOWIZSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
25.3274 -10.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3262 -10.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0343 -11.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7439 -10.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7411 -10.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0325 -9.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0341 -12.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3263 -12.5864 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
26.7417 -12.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7415 -13.4040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4495 -12.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1571 -12.5871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4497 -11.3612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8649 -12.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5725 -12.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8651 -11.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5729 -10.9531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5723 -13.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4491 -13.8127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4489 -14.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1569 -13.4043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7421 -15.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7415 -15.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4496 -16.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1598 -15.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1569 -15.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8649 -13.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8644 -14.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5725 -15.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2827 -14.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2797 -13.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6196 -9.7239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6194 -8.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9116 -8.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2040 -8.9070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4962 -8.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2042 -9.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4965 -10.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7885 -8.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
14 12 1 6
14 15 1 0
14 16 1 0
16 17 1 0
15 18 1 0
10 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
18 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 18 1 0
1 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 1 0
37 38 1 0
36 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.55Molecular Weight (Monoisotopic): 593.1889AlogP: 4.62#Rotatable Bonds: 14Polar Surface Area: 90.90Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.11CX Basic pKa: 9.30CX LogP: 4.35CX LogD: 2.45Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -0.81
References 1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J. (2021) Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents., 29 [PMID:33285406 ] [10.1016/j.bmc.2020.115892 ]