(S,Z)-N-(1-bromo-1-(3-(2-(diethylamino)ethoxy)phenyl)-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-3-oxoprop-1-en-2-yl)benzamide

ID: ALA4745160

PubChem CID: 162647943

Max Phase: Preclinical

Molecular Formula: C31H36BrN3O4

Molecular Weight: 594.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CCOc1cccc(/C(Br)=C(/NC(=O)c2ccccc2)C(=O)N[C@H](CO)Cc2ccccc2)c1

Standard InChI:  InChI=1S/C31H36BrN3O4/c1-3-35(4-2)18-19-39-27-17-11-16-25(21-27)28(32)29(34-30(37)24-14-9-6-10-15-24)31(38)33-26(22-36)20-23-12-7-5-8-13-23/h5-17,21,26,36H,3-4,18-20,22H2,1-2H3,(H,33,38)(H,34,37)/b29-28-/t26-/m0/s1

Standard InChI Key:  ISUFNOJOHUTUNL-KVMGOWIZSA-N

Molfile:  

 
     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
   25.3274  -10.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3262  -10.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0343  -11.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7439  -10.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7411  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0325   -9.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0341  -12.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3263  -12.5864    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   26.7417  -12.5868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7415  -13.4040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4495  -12.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1571  -12.5871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4497  -11.3612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8649  -12.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5725  -12.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8651  -11.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5729  -10.9531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5723  -13.4047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4491  -13.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4489  -14.6299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1569  -13.4043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7421  -15.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7415  -15.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4496  -16.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1598  -15.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1569  -15.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8649  -13.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8644  -14.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5725  -15.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2827  -14.6220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2797  -13.8069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6196   -9.7239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6194   -8.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9116   -8.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2040   -8.9070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4962   -8.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2042   -9.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4965  -10.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7885   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  6
 14 15  1  0
 14 16  1  0
 16 17  1  0
 15 18  1  0
 10 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 18 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 18  1  0
  1 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4745160

    ---

Associated Targets(Human)

HepG2 2.2.15 (869 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 594.55Molecular Weight (Monoisotopic): 593.1889AlogP: 4.62#Rotatable Bonds: 14
Polar Surface Area: 90.90Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.11CX Basic pKa: 9.30CX LogP: 4.35CX LogD: 2.45
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -0.81

References

1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J.  (2021)  Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents.,  29  [PMID:33285406] [10.1016/j.bmc.2020.115892]

Source