The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N4-tert-butoxy-2-(2-morpholinoacetamido)-N1-((S)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl)succinamide ID: ALA4745162
PubChem CID: 129071788
Max Phase: Preclinical
Molecular Formula: C28H39N5O6
Molecular Weight: 541.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)[C@H](CC(=O)NOC(C)(C)C)NC(=O)CN1CCOCC1)C(=O)NCc1cccc2ccccc12
Standard InChI: InChI=1S/C28H39N5O6/c1-19(26(36)29-17-21-10-7-9-20-8-5-6-11-22(20)21)30-27(37)23(16-24(34)32-39-28(2,3)4)31-25(35)18-33-12-14-38-15-13-33/h5-11,19,23H,12-18H2,1-4H3,(H,29,36)(H,30,37)(H,31,35)(H,32,34)/t19-,23-/m0/s1
Standard InChI Key: IFSHPYDBGCJZAJ-CVDCTZTESA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
14.3998 -8.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5581 -12.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9748 -11.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1494 -11.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1165 -8.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8289 -8.2124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5415 -8.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2540 -8.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9664 -8.6165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6790 -8.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3914 -8.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1039 -8.1999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8164 -8.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5289 -8.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5433 -9.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2522 -7.3833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3932 -9.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6771 -7.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1175 -9.4499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9534 -7.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2349 -6.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5259 -7.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2586 -9.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2604 -10.6817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9722 -9.4426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9758 -11.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6930 -12.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9600 -8.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2430 -8.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2423 -9.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9580 -9.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6759 -9.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6730 -8.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6859 -8.6258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9734 -8.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2617 -8.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2585 -9.4453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9733 -9.8590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6914 -9.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
7 15 1 6
8 16 2 0
11 17 2 0
10 18 1 1
5 1 1 0
5 19 2 0
14 29 2 0
28 20 2 0
20 21 1 0
21 22 2 0
22 14 1 0
15 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 3 1 0
3 27 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
1 34 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.65Molecular Weight (Monoisotopic): 541.2900AlogP: 1.01#Rotatable Bonds: 11Polar Surface Area: 138.10Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.41CX Basic pKa: 4.99CX LogP: 0.49CX LogD: 0.45Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -1.04
References 1. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G. (2020) Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides., 63 (21): [PMID:33095579 ] [10.1021/acs.jmedchem.0c01520 ]