2-[(1S)-1-(4-Fluorophenyl)ethyl]-7-methyl-5-[3-(pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2,3-dihydro-1H-isoindol-1-one

ID: ALA4745196

PubChem CID: 162648434

Max Phase: Preclinical

Molecular Formula: C29H23FN4O

Molecular Weight: 462.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3[nH]cc(-c4ccncc4)c3c2)cc2c1C(=O)N([C@@H](C)c1ccc(F)cc1)C2

Standard InChI:  InChI=1S/C29H23FN4O/c1-17-11-21(22-13-25-26(15-33-28(25)32-14-22)20-7-9-31-10-8-20)12-23-16-34(29(35)27(17)23)18(2)19-3-5-24(30)6-4-19/h3-15,18H,16H2,1-2H3,(H,32,33)/t18-/m0/s1

Standard InChI Key:  VDVXAZJBPVHKHO-SFHVURJKSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   41.4896  -23.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4885  -24.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1965  -24.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1947  -22.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9033  -23.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9081  -24.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6882  -24.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1655  -23.6841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.6804  -23.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9827  -23.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3955  -24.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9452  -25.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1976  -25.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3871  -22.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7839  -22.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7850  -22.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0780  -21.6509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0798  -23.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3723  -22.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3654  -22.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5862  -21.8182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1115  -22.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5974  -23.1401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9885  -25.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4006  -25.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2186  -25.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6229  -25.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2085  -24.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6323  -26.4986    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.3530  -23.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5538  -24.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3078  -24.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8600  -25.4740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6614  -25.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9037  -24.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
  7 12  2  0
  3 13  1  0
 10 14  1  1
 15 16  2  0
 16 17  1  0
 17 20  2  0
 19 18  2  0
 18 15  1  0
  1 15  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 11 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 11  1  0
 26 29  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 23 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4745196

    ---

Associated Targets(Human)

PIK3CG Tclin PI3-kinase p110-gamma subunit (5411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.53Molecular Weight (Monoisotopic): 462.1856AlogP: 6.46#Rotatable Bonds: 4
Polar Surface Area: 61.88Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.66CX LogP: 5.14CX LogD: 5.14
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.67

References

1. Miles DH,Yan X,Thomas-Tran R,Fournier J,Sharif EU,Drew SL,Mata G,Lawson KV,Ginn E,Wong K,Soni D,Dhanota P,Shaqfeh SG,Meleza C,Chen A,Pham AT,Park T,Swinarski D,Banuelos J,Schindler U,Walters MJ,Walker NP,Zhao X,Young SW,Chen J,Jin L,Leleti MR,Powers JP,Jeffrey JL.  (2020)  Discovery of Potent and Selective 7-Azaindole Isoindolinone-Based PI3Kγ Inhibitors.,  11  (11): [PMID:33214836] [10.1021/acsmedchemlett.0c00387]

Source