4-methyl-N-(5-(3-nitrophenyl)thiazol-2-yl)benzenesulfonamide

ID: ALA4745247

PubChem CID: 162648850

Max Phase: Preclinical

Molecular Formula: C16H13N3O4S2

Molecular Weight: 375.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)Nc2ncc(-c3cccc([N+](=O)[O-])c3)s2)cc1

Standard InChI:  InChI=1S/C16H13N3O4S2/c1-11-5-7-14(8-6-11)25(22,23)18-16-17-10-15(24-16)12-3-2-4-13(9-12)19(20)21/h2-10H,1H3,(H,17,18)

Standard InChI Key:  GYPGZXIKOLUMCR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    7.9532   -3.9786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6631   -4.3872    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6620   -3.5682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9607   -5.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9596   -6.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6676   -6.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3773   -6.4857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3745   -5.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6658   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0802   -5.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8280   -5.5788    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3725   -4.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9612   -4.2633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1626   -4.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1856   -5.0518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4764   -4.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8087   -5.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6209   -5.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0996   -4.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7603   -3.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9490   -3.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9127   -4.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2522   -5.2585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5446   -5.6672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2520   -4.4413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 12 15  1  0
 15  2  1  0
  2 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 23 24  2  0
 23 25  1  0
  4 23  1  0
M  CHG  2  23   1  25  -1
M  END

Alternative Forms

  1. Parent:

    ALA4745247

    ---

Associated Targets(Human)

KMO Tchem Kynurenine 3-monooxygenase (379 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Kmo Kynurenine 3-monooxygenase (34 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.43Molecular Weight (Monoisotopic): 375.0347AlogP: 3.83#Rotatable Bonds: 5
Polar Surface Area: 102.20Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.81CX Basic pKa: 0.35CX LogP: 3.90CX LogD: 3.37
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.54Np Likeness Score: -2.03

References

1. Kimura H,Suda H,Kassai M,Endo M,Deai Y,Yahata M,Miyajima M,Isobe Y.  (2021)  N-(6-phenylpyridazin-3-yl)benzenesulfonamides as highly potent, brain-permeable, and orally active kynurenine monooxygenase inhibitors.,  33  [PMID:33359168] [10.1016/j.bmcl.2020.127753]

Source