N-benzyl-2-((2-(piperidin-1-yl)quinolin-8-yl)oxy)acetamide

ID: ALA4745288

PubChem CID: 18570632

Max Phase: Preclinical

Molecular Formula: C23H25N3O2

Molecular Weight: 375.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(COc1cccc2ccc(N3CCCCC3)nc12)NCc1ccccc1

Standard InChI:  InChI=1S/C23H25N3O2/c27-22(24-16-18-8-3-1-4-9-18)17-28-20-11-7-10-19-12-13-21(25-23(19)20)26-14-5-2-6-15-26/h1,3-4,7-13H,2,5-6,14-17H2,(H,24,27)

Standard InChI Key:  SXUGQAOGAKNBLC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    5.3484  -21.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3472  -22.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0620  -23.2186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0603  -21.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7756  -21.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7763  -22.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4917  -23.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2066  -22.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2019  -21.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4860  -21.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4934  -24.0376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2086  -24.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9223  -24.0345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6375  -24.4456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9206  -23.2095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3511  -24.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0664  -24.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0653  -25.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7797  -25.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4943  -25.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4899  -24.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7749  -24.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6325  -23.2177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9198  -22.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2072  -23.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2022  -24.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9161  -24.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6350  -24.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  7 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  2 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Respiratory syncytial virus (3434 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.47Molecular Weight (Monoisotopic): 375.1947AlogP: 3.92#Rotatable Bonds: 6
Polar Surface Area: 54.46Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.80CX Basic pKa: 4.01CX LogP: 4.15CX LogD: 4.15
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: -1.73

References

1. Wang M,Zhang G,Zhao J,Cheng N,Wang Y,Fu Y,Zheng Y,Wang J,Zhu M,Cen S,He J,Wang Y.  (2021)  Synthesis and antiviral activity of a series of novel quinoline derivatives as anti-RSV or anti-IAV agents.,  214  [PMID:33571829] [10.1016/j.ejmech.2021.113208]

Source