The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-difluoro-N-(2-methoxy-5-(4-morpholinothieno[2,3-d]pyrimidin-6-yl)pyridin-3-yl)benzenesulfonamide ID: ALA4745332
PubChem CID: 162371682
Max Phase: Preclinical
Molecular Formula: C22H19F2N5O4S2
Molecular Weight: 519.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(-c2cc3c(N4CCOCC4)ncnc3s2)cc1NS(=O)(=O)c1ccc(F)cc1F
Standard InChI: InChI=1S/C22H19F2N5O4S2/c1-32-21-17(28-35(30,31)19-3-2-14(23)9-16(19)24)8-13(11-25-21)18-10-15-20(26-12-27-22(15)34-18)29-4-6-33-7-5-29/h2-3,8-12,28H,4-7H2,1H3
Standard InChI Key: HFDGVAZLABKEEV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
15.6463 -4.3336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6505 -5.1508 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.3561 -4.7386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7058 -3.3306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7047 -4.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4788 -4.6582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4109 -2.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1196 -3.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1198 -4.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9028 -4.4044 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.3865 -3.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9024 -3.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2004 -3.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6087 -4.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4251 -4.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8343 -3.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4211 -3.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6060 -3.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6515 -3.7360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0589 -3.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8336 -5.1536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0593 -5.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6479 -6.5678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0557 -7.2751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8737 -7.2757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2823 -6.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8721 -5.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8307 -6.5661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.2832 -7.9829 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4108 -2.1080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1191 -1.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1187 -0.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4115 -0.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7032 -0.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7021 -1.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 13 1 0
16 19 1 0
19 20 1 0
15 21 1 0
21 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
25 29 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
7 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.56Molecular Weight (Monoisotopic): 519.0847AlogP: 3.68#Rotatable Bonds: 6Polar Surface Area: 106.54Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.56CX Basic pKa: 3.79CX LogP: 3.41CX LogD: 2.77Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -2.35
References 1. Sun Y,Fu R,Lin S,Zhang J,Ji M,Zhang Y,Wu D,Zhang K,Tian H,Zhang M,Sheng L,Li Y,Jin J,Chen X,Xu H. (2021) Discovery of new thieno[2,3-d]pyrimidine and thiazolo[5,4-d]pyrimidine derivatives as orally active phosphoinositide 3-kinase inhibitors., 29 [PMID:33285407 ] [10.1016/j.bmc.2020.115890 ]