The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3,5-bis(trifluoromethyl)benzyl)-4-(4-tert-butylphenyl)-1H-1,2,3-triazole ID: ALA4745365
PubChem CID: 162649104
Max Phase: Preclinical
Molecular Formula: C21H19F6N3
Molecular Weight: 427.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(-c2cn(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)nn2)cc1
Standard InChI: InChI=1S/C21H19F6N3/c1-19(2,3)15-6-4-14(5-7-15)18-12-30(29-28-18)11-13-8-16(20(22,23)24)10-17(9-13)21(25,26)27/h4-10,12H,11H2,1-3H3
Standard InChI Key: WOQNDFJLDADQJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.0569 -22.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0557 -23.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7638 -23.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4734 -23.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4706 -22.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7620 -22.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1768 -22.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8860 -22.6330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9781 -23.4443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7781 -23.6112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1841 -22.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6349 -22.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9924 -22.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4748 -23.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2865 -23.3864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6168 -22.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1293 -21.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3193 -22.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4290 -22.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9128 -23.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7575 -21.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2426 -22.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7636 -24.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0558 -25.0961 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.4712 -25.0964 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7558 -25.5021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.3491 -22.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3489 -21.4163 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6414 -22.6423 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6385 -21.8248 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 13 1 0
8 9 1 0
16 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
3 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
1 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.39Molecular Weight (Monoisotopic): 427.1483AlogP: 6.33#Rotatable Bonds: 3Polar Surface Area: 30.71Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.08CX LogD: 7.08Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.52
References 1. Xu M,Zhao C,Zhu B,Wang L,Zhou H,Yan D,Gu Q,Xu J. (2021) Discovering High Potent Hsp90 Inhibitors as Antinasopharyngeal Carcinoma Agents through Fragment Assembling Approach., 64 (4.0): [PMID:33543615 ] [10.1021/acs.jmedchem.0c01521 ]