The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((5-((4-Phenoxyphenyl)carbamoyl)-2-(m-tolyloxy)thiazol-4-yl)amino)-2-oxoacetic acid ID: ALA4745481
PubChem CID: 162648715
Max Phase: Preclinical
Molecular Formula: C25H19N3O6S
Molecular Weight: 489.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(Oc2nc(NC(=O)C(=O)O)c(C(=O)Nc3ccc(Oc4ccccc4)cc3)s2)c1
Standard InChI: InChI=1S/C25H19N3O6S/c1-15-6-5-9-19(14-15)34-25-28-21(27-23(30)24(31)32)20(35-25)22(29)26-16-10-12-18(13-11-16)33-17-7-3-2-4-8-17/h2-14H,1H3,(H,26,29)(H,27,30)(H,31,32)
Standard InChI Key: SVFBLFISRDPCCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
18.8498 -14.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5643 -14.3957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1354 -14.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8498 -15.6332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2787 -14.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2762 -15.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9897 -16.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7052 -15.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7026 -14.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9883 -14.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0443 -13.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2374 -13.4020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8249 -14.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3769 -14.7296 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.6559 -13.0199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4821 -12.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0937 -11.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6968 -11.9606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8790 -11.9124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9199 -10.8532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9999 -14.1123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5910 -13.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0096 -12.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6014 -11.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7756 -11.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3596 -12.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7701 -13.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5346 -12.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4203 -16.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1341 -15.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8454 -16.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5588 -15.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5582 -14.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8382 -14.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1276 -14.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 3 1 0
11 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
17 20 1 0
13 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
26 28 1 0
8 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.51Molecular Weight (Monoisotopic): 489.0995AlogP: 5.31#Rotatable Bonds: 7Polar Surface Area: 126.85Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.51CX Basic pKa: ┄CX LogP: 5.85CX LogD: 2.29Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.05