2-((5-((4-Phenoxyphenyl)carbamoyl)-2-(m-tolyloxy)thiazol-4-yl)amino)-2-oxoacetic acid

ID: ALA4745481

PubChem CID: 162648715

Max Phase: Preclinical

Molecular Formula: C25H19N3O6S

Molecular Weight: 489.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(Oc2nc(NC(=O)C(=O)O)c(C(=O)Nc3ccc(Oc4ccccc4)cc3)s2)c1

Standard InChI:  InChI=1S/C25H19N3O6S/c1-15-6-5-9-19(14-15)34-25-28-21(27-23(30)24(31)32)20(35-25)22(29)26-16-10-12-18(13-11-16)33-17-7-3-2-4-8-17/h2-14H,1H3,(H,26,29)(H,27,30)(H,31,32)

Standard InChI Key:  SVFBLFISRDPCCQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   18.8498  -14.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5643  -14.3957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1354  -14.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8498  -15.6332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2787  -14.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2762  -15.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9897  -16.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7052  -15.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7026  -14.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9883  -14.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0443  -13.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2374  -13.4020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8249  -14.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3769  -14.7296    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.6559  -13.0199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4821  -12.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0937  -11.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6968  -11.9606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8790  -11.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9199  -10.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9999  -14.1123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5910  -13.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0096  -12.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6014  -11.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7756  -11.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3596  -12.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7701  -13.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5346  -12.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4203  -16.0457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1341  -15.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8454  -16.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5588  -15.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5582  -14.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8382  -14.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1276  -14.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  3  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 17 20  1  0
 13 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 26 28  1  0
  8 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4745481

    ---

Associated Targets(Human)

PIN1 Tchem Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 (36611 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.51Molecular Weight (Monoisotopic): 489.0995AlogP: 5.31#Rotatable Bonds: 7
Polar Surface Area: 126.85Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.51CX Basic pKa: CX LogP: 5.85CX LogD: 2.29
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.05

References

1. Zhao H,Cui G,Jin J,Chen X,Xu B.  (2016)  Synthesis and Pin1 inhibitory activity of thiazole derivatives.,  24  (22.0): [PMID:27692510] [10.1016/j.bmc.2016.09.049]

Source