(2-(4-Hydroxy-4-methylpiperidin-1-yl)-5-(naphthalen-2-ylcarbamoyl)thiazol-4-yl)glycine

ID: ALA4745501

PubChem CID: 162648872

Max Phase: Preclinical

Molecular Formula: C22H24N4O4S

Molecular Weight: 440.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(O)CCN(c2nc(NCC(=O)O)c(C(=O)Nc3ccc4ccccc4c3)s2)CC1

Standard InChI:  InChI=1S/C22H24N4O4S/c1-22(30)8-10-26(11-9-22)21-25-19(23-13-17(27)28)18(31-21)20(29)24-16-7-6-14-4-2-3-5-15(14)12-16/h2-7,12,23,30H,8-11,13H2,1H3,(H,24,29)(H,27,28)

Standard InChI Key:  VXNMFCGQKXDPFB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   37.7559   -4.9981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.4658   -4.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7606   -4.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4434   -6.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.1531   -5.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.1503   -5.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4416   -4.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7354   -5.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7377   -5.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0317   -4.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3230   -5.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3247   -5.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0312   -6.2452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6153   -4.6105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9076   -5.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1998   -4.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9078   -5.8364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1140   -3.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3146   -3.6317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9061   -4.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4531   -4.9466    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.7210   -3.2543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5506   -2.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1576   -1.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9872   -1.1087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9349   -2.1600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0934   -4.4252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6129   -3.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7612   -5.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9485   -5.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8002   -3.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 16  1  0
 18 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 20 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 28 31  1  0
 30  2  1  0
 31  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4745501

    ---

Associated Targets(Human)

PIN1 Tchem Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 (36611 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.53Molecular Weight (Monoisotopic): 440.1518AlogP: 3.40#Rotatable Bonds: 6
Polar Surface Area: 114.79Molecular Species: ACIDHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 4.17CX Basic pKa: 0.22CX LogP: 3.43CX LogD: 0.38
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.02

References

1. Du L,Wang X,Cui G,Xu B.  (2021)  Design, synthesis and biological evaluation of novel thiazole-based derivatives as human Pin1 inhibitors.,  29  [PMID:33246256] [10.1016/j.bmc.2020.115878]

Source