The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2-(4-Hydroxy-4-methylpiperidin-1-yl)-5-(naphthalen-2-ylcarbamoyl)thiazol-4-yl)glycine ID: ALA4745501
PubChem CID: 162648872
Max Phase: Preclinical
Molecular Formula: C22H24N4O4S
Molecular Weight: 440.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(O)CCN(c2nc(NCC(=O)O)c(C(=O)Nc3ccc4ccccc4c3)s2)CC1
Standard InChI: InChI=1S/C22H24N4O4S/c1-22(30)8-10-26(11-9-22)21-25-19(23-13-17(27)28)18(31-21)20(29)24-16-7-6-14-4-2-3-5-15(14)12-16/h2-7,12,23,30H,8-11,13H2,1H3,(H,24,29)(H,27,28)
Standard InChI Key: VXNMFCGQKXDPFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
37.7559 -4.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4658 -4.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7606 -4.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4434 -6.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1531 -5.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1503 -5.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4416 -4.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7354 -5.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7377 -5.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0317 -4.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3230 -5.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3247 -5.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0312 -6.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6153 -4.6105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9076 -5.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1998 -4.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9078 -5.8364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1140 -3.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3146 -3.6317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9061 -4.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4531 -4.9466 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.7210 -3.2543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5506 -2.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1576 -1.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9872 -1.1087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9349 -2.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0934 -4.4252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6129 -3.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7612 -5.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9485 -5.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8002 -3.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
11 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 16 1 0
18 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
20 27 1 0
27 28 1 0
27 29 1 0
29 30 1 0
28 31 1 0
30 2 1 0
31 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.53Molecular Weight (Monoisotopic): 440.1518AlogP: 3.40#Rotatable Bonds: 6Polar Surface Area: 114.79Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.17CX Basic pKa: 0.22CX LogP: 3.43CX LogD: 0.38Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.02
References 1. Du L,Wang X,Cui G,Xu B. (2021) Design, synthesis and biological evaluation of novel thiazole-based derivatives as human Pin1 inhibitors., 29 [PMID:33246256 ] [10.1016/j.bmc.2020.115878 ]