The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S)-3-cyclopropyl-3-[3-[[6-(2,2-dimethylpropyl)-5-(2-fluoro-5-methoxyphenyl)pyrazin-2-yl]methoxy]phenyl]propanoic acid ID: ALA4745513
PubChem CID: 118645685
Max Phase: Preclinical
Molecular Formula: C29H33FN2O4
Molecular Weight: 492.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(F)c(-c2ncc(COc3cccc([C@@H](CC(=O)O)C4CC4)c3)nc2CC(C)(C)C)c1
Standard InChI: InChI=1S/C29H33FN2O4/c1-29(2,3)15-26-28(24-13-21(35-4)10-11-25(24)30)31-16-20(32-26)17-36-22-7-5-6-19(12-22)23(14-27(33)34)18-8-9-18/h5-7,10-13,16,18,23H,8-9,14-15,17H2,1-4H3,(H,33,34)/t23-/m0/s1
Standard InChI Key: WOLFEJUCBJJIIB-QHCPKHFHSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
5.2897 -26.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2885 -27.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0007 -27.7211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7145 -27.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7117 -26.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9989 -26.0755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5784 -26.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4173 -26.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1271 -26.4737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5813 -27.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8740 -27.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1661 -27.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1642 -28.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8762 -28.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5812 -28.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2894 -28.9374 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4593 -27.3008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4611 -26.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8327 -26.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5399 -26.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2450 -26.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2414 -25.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5267 -24.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8244 -25.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9546 -26.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6604 -26.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3700 -26.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0758 -26.0446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3737 -27.2735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9583 -27.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5561 -27.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3733 -27.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5797 -25.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2880 -24.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8726 -24.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5730 -24.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
5 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
15 16 1 0
12 17 1 0
17 18 1 0
9 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
21 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
25 30 1 1
31 30 1 0
32 31 1 0
30 32 1 0
7 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.59Molecular Weight (Monoisotopic): 492.2424AlogP: 6.43#Rotatable Bonds: 10Polar Surface Area: 81.54Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.93CX Basic pKa: ┄CX LogP: 5.71CX LogD: 2.51Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.56
References 1. Meegalla SK,Huang H,Martin T,Xu J,Zhao S,Liu J,Hall M,Gunnet J,Wang Y,Rady B,Silva J,Otieno M,Arnoult E,Paul Lee S,Pocai A,Player MR. (2018) Discovery of a novel potent GPR40 full agonist., 28 (4): [PMID:29366647 ] [10.1016/j.bmcl.2018.01.013 ]