The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(Propyl)guanidino)]-5[4-(2-aminoimidazolino)benzyl]pyridine dihydrochloride ID: ALA4745647
PubChem CID: 162648277
Max Phase: Preclinical
Molecular Formula: C19H27Cl2N7
Molecular Weight: 351.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=N)Nc1ccc(Cc2ccc(NC3=NCCN3)cc2)cn1.Cl.Cl
Standard InChI: InChI=1S/C19H25N7.2ClH/c1-2-9-21-18(20)26-17-8-5-15(13-24-17)12-14-3-6-16(7-4-14)25-19-22-10-11-23-19;;/h3-8,13H,2,9-12H2,1H3,(H2,22,23,25)(H3,20,21,24,26);2*1H
Standard InChI Key: OFLVIOYZWFGNNZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
30.9080 -29.9063 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.5175 -27.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5163 -28.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2310 -28.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9475 -28.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9446 -27.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2292 -27.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6574 -27.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3734 -27.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3731 -28.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0882 -28.6624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8021 -28.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7963 -27.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0807 -27.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5185 -28.6560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2309 -28.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8015 -28.6784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0875 -28.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2267 -27.4151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9473 -28.6487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0008 -27.4471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1941 -27.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7810 -27.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3326 -28.6024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6597 -28.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3761 -28.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0885 -28.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1437 -26.8714 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
3 17 1 0
17 18 1 0
16 19 2 0
16 20 1 0
18 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 18 1 0
20 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 351.46Molecular Weight (Monoisotopic): 351.2171AlogP: 2.39#Rotatable Bonds: 6Polar Surface Area: 97.22Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.30CX LogP: 2.88CX LogD: 1.50Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.41Np Likeness Score: -0.67
References 1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I. (2021) Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity., 209 [PMID:33139112 ] [10.1016/j.ejmech.2020.112947 ]