The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4747375
PubChem CID: 162650136
Max Phase: Preclinical
Molecular Formula: C26H30FN7O4
Molecular Weight: 523.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCNC(=O)COc2ccc(F)cc2C(=O)N2CCCC[C@H]2c2cc3nc(N4CC(O)C4)cc1n3n2
Standard InChI: InChI=1S/C26H30FN7O4/c1-31-9-7-28-24(36)15-38-21-6-5-16(27)10-18(21)26(37)33-8-3-2-4-20(33)19-11-23-29-22(32-13-17(35)14-32)12-25(31)34(23)30-19/h5-6,10-12,17,20,35H,2-4,7-9,13-15H2,1H3,(H,28,36)/t20-/m0/s1
Standard InChI Key: HGIJILGBDQCWNL-FQEVSTJZSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
36.9923 -18.4652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6733 -18.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7831 -21.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7831 -22.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4884 -22.6874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4884 -21.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1936 -21.4657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1981 -22.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9777 -22.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4550 -21.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9704 -21.2087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2699 -21.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6812 -22.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4948 -22.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9033 -21.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4920 -21.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6722 -21.1531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0767 -22.6942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2871 -22.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0767 -23.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8664 -23.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4884 -20.2358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7806 -19.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2604 -20.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6658 -19.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4432 -20.4510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4828 -19.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8881 -19.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4762 -18.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6548 -18.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2532 -19.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4360 -19.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5953 -19.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0551 -19.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7052 -19.0237 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.8537 -22.5677 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
37.7972 -19.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2831 -18.1068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3696 -23.6832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
3 6 2 0
4 5 2 0
5 8 1 0
7 6 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
10 12 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 18 1 0
4 18 1 0
6 22 1 0
22 34 1 0
22 23 1 0
17 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
31 32 1 0
1 33 1 0
33 34 1 0
28 35 1 0
12 36 1 6
32 37 1 0
37 2 1 0
2 1 1 0
2 38 2 0
20 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.57Molecular Weight (Monoisotopic): 523.2343AlogP: 1.36#Rotatable Bonds: 1Polar Surface Area: 115.54Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.23CX Basic pKa: 3.69CX LogP: 1.63CX LogD: 1.63Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -0.94
References 1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M. (2020) Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties., 28 (24): [PMID:33190073 ] [10.1016/j.bmc.2020.115818 ]