NA

ID: ALA4747375

PubChem CID: 162650136

Max Phase: Preclinical

Molecular Formula: C26H30FN7O4

Molecular Weight: 523.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCNC(=O)COc2ccc(F)cc2C(=O)N2CCCC[C@H]2c2cc3nc(N4CC(O)C4)cc1n3n2

Standard InChI:  InChI=1S/C26H30FN7O4/c1-31-9-7-28-24(36)15-38-21-6-5-16(27)10-18(21)26(37)33-8-3-2-4-20(33)19-11-23-29-22(32-13-17(35)14-32)12-25(31)34(23)30-19/h5-6,10-12,17,20,35H,2-4,7-9,13-15H2,1H3,(H,28,36)/t20-/m0/s1

Standard InChI Key:  HGIJILGBDQCWNL-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   36.9923  -18.4652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6733  -18.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7831  -21.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7831  -22.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4884  -22.6874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4884  -21.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1936  -21.4657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1981  -22.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9777  -22.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4550  -21.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9704  -21.2087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2699  -21.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6812  -22.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4948  -22.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9033  -21.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4920  -21.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6722  -21.1531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0767  -22.6942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2871  -22.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0767  -23.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8664  -23.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4884  -20.2358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7806  -19.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2604  -20.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6658  -19.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4432  -20.4510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4828  -19.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8881  -19.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4762  -18.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6548  -18.3265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2532  -19.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4360  -19.0424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5953  -19.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0551  -19.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7052  -19.0237    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.8537  -22.5677    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.7972  -19.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2831  -18.1068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3696  -23.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  3  6  2  0
  4  5  2  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 10 12  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 18  1  0
  4 18  1  0
  6 22  1  0
 22 34  1  0
 22 23  1  0
 17 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 31 32  1  0
  1 33  1  0
 33 34  1  0
 28 35  1  0
 12 36  1  6
 32 37  1  0
 37  2  1  0
  2  1  1  0
  2 38  2  0
 20 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4747375

    ---

Associated Targets(non-human)

F Fusion glycoprotein F0 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.57Molecular Weight (Monoisotopic): 523.2343AlogP: 1.36#Rotatable Bonds: 1
Polar Surface Area: 115.54Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.23CX Basic pKa: 3.69CX LogP: 1.63CX LogD: 1.63
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -0.94

References

1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M.  (2020)  Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties.,  28  (24): [PMID:33190073] [10.1016/j.bmc.2020.115818]

Source