The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((2-(9H-fluoren-9-yl)ethyl)(methyl)amino)-1-(4-(3-chlorophenyl)piperazin-1-yl)propan-1-one hydrochloride ID: ALA474745
PubChem CID: 44564902
Max Phase: Preclinical
Molecular Formula: C29H33Cl2N3O
Molecular Weight: 474.05
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)CCC1c2ccccc2-c2ccccc21.Cl
Standard InChI: InChI=1S/C29H32ClN3O.ClH/c1-31(15-13-28-26-11-4-2-9-24(26)25-10-3-5-12-27(25)28)16-14-29(34)33-19-17-32(18-20-33)23-8-6-7-22(30)21-23;/h2-12,21,28H,13-20H2,1H3;1H
Standard InChI Key: WXEQAWPFZSLVCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
7.8914 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.0636 0.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6508 0.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3653 0.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0798 0.0610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3653 1.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0798 -0.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7942 -1.1765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5087 -0.7640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5087 0.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7942 0.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2232 -1.1765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9376 -0.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6521 -1.1765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6521 -2.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9376 -2.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2232 -2.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7781 0.0610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7781 -0.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4926 0.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2071 0.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9215 0.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2272 0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6752 0.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9301 -0.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7371 -0.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2891 -0.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0342 0.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0078 1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8147 1.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0697 2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5176 2.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7107 2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4557 1.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9376 -3.2390 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5 11 1 0
2 18 1 0
7 8 1 0
18 19 1 0
8 9 1 0
18 20 1 0
9 10 1 0
20 21 1 0
10 11 1 0
21 22 1 0
22 24 1 0
23 30 1 0
29 22 1 0
23 24 2 0
5 7 1 0
9 12 1 0
3 4 1 0
12 13 2 0
2 3 1 0
13 14 1 0
23 28 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
29 30 2 0
4 5 1 0
14 15 2 0
15 16 1 0
4 6 2 0
16 17 2 0
29 34 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
17 12 1 0
16 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.05Molecular Weight (Monoisotopic): 473.2234AlogP: 5.51#Rotatable Bonds: 7Polar Surface Area: 26.79Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.54CX LogP: 5.44CX LogD: 3.31Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.19
References 1. Troxler T, Hurth K, Mattes H, Prashad M, Schoeffter P, Langenegger D, Enz A, Hoyer D.. (2009) Discovery of novel non-peptidic beta-alanine piperazine amide derivatives and their optimization to achiral, easily accessible, potent and selective somatostatin sst1 receptor antagonists., 19 (5): [PMID:19208473 ] [10.1016/j.bmcl.2009.01.072 ]