3-((2-(9H-fluoren-9-yl)ethyl)(methyl)amino)-1-(4-(3-chlorophenyl)piperazin-1-yl)propan-1-one hydrochloride

ID: ALA474745

PubChem CID: 44564902

Max Phase: Preclinical

Molecular Formula: C29H33Cl2N3O

Molecular Weight: 474.05

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)CCC1c2ccccc2-c2ccccc21.Cl

Standard InChI:  InChI=1S/C29H32ClN3O.ClH/c1-31(15-13-28-26-11-4-2-9-24(26)25-10-3-5-12-27(25)28)16-14-29(34)33-19-17-32(18-20-33)23-8-6-7-22(30)21-23;/h2-12,21,28H,13-20H2,1H3;1H

Standard InChI Key:  WXEQAWPFZSLVCZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    7.8914    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.0636    0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6508    0.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3653    0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0798    0.0610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3653    1.2985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0798   -0.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7942   -1.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5087   -0.7640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5087    0.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7942    0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2232   -1.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9376   -0.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6521   -1.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6521   -2.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9376   -2.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2232   -2.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7781    0.0610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7781   -0.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4926    0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2071    0.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9215    0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2272    0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6752    0.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9301   -0.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7371   -0.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2891   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0342    0.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0078    1.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8147    1.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0697    2.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5176    2.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7107    2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4557    1.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9376   -3.2390    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  5 11  1  0
  2 18  1  0
  7  8  1  0
 18 19  1  0
  8  9  1  0
 18 20  1  0
  9 10  1  0
 20 21  1  0
 10 11  1  0
 21 22  1  0
 22 24  1  0
 23 30  1  0
 29 22  1  0
 23 24  2  0
  5  7  1  0
  9 12  1  0
  3  4  1  0
 12 13  2  0
  2  3  1  0
 13 14  1  0
 23 28  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 29 30  2  0
  4  5  1  0
 14 15  2  0
 15 16  1  0
  4  6  2  0
 16 17  2  0
 29 34  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 17 12  1  0
 16 35  1  0
M  END

Associated Targets(non-human)

Sstr1 Somatostatin receptor 1 (154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.05Molecular Weight (Monoisotopic): 473.2234AlogP: 5.51#Rotatable Bonds: 7
Polar Surface Area: 26.79Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.54CX LogP: 5.44CX LogD: 3.31
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.19

References

1. Troxler T, Hurth K, Mattes H, Prashad M, Schoeffter P, Langenegger D, Enz A, Hoyer D..  (2009)  Discovery of novel non-peptidic beta-alanine piperazine amide derivatives and their optimization to achiral, easily accessible, potent and selective somatostatin sst1 receptor antagonists.,  19  (5): [PMID:19208473] [10.1016/j.bmcl.2009.01.072]

Source