The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl ((3-(3-(2-(2-cyclopropyl-1H-imidazol-1-yl)acetyl)phenyl)-5-isobutylthiophen-2-yl)sulfonyl)carbamate ID: ALA4747530
PubChem CID: 162650706
Max Phase: Preclinical
Molecular Formula: C25H29N3O5S2
Molecular Weight: 515.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2C2CC2)c1
Standard InChI: InChI=1S/C25H29N3O5S2/c1-4-33-25(30)27-35(31,32)24-21(14-20(34-24)12-16(2)3)18-6-5-7-19(13-18)22(29)15-28-11-10-26-23(28)17-8-9-17/h5-7,10-11,13-14,16-17H,4,8-9,12,15H2,1-3H3,(H,27,30)
Standard InChI Key: VPJYDALZQJGKRV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
11.8156 -9.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4009 -9.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4802 -4.6658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2187 -10.8669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1872 -6.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0097 -6.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7795 -6.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6351 -10.7831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5130 -5.4886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5839 -9.9673 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.6977 -5.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1550 -10.1914 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.9884 -9.2574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7133 -7.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3418 -7.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0454 -8.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7152 -9.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3155 -12.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2197 -11.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1958 -6.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9492 -11.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1825 -5.4531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7461 -8.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9976 -12.0485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5851 -10.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9648 -6.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5633 -8.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7970 -4.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4932 -9.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8204 -11.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1614 -4.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8597 -8.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4275 -6.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0627 -6.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3636 -13.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 32 1 0
28 9 1 0
11 9 1 0
16 14 1 0
26 9 1 0
14 20 2 0
29 12 1 0
21 8 1 0
10 13 2 0
11 5 1 0
10 1 1 0
23 29 2 0
31 28 2 0
27 16 1 0
17 25 1 0
21 4 2 0
11 3 2 0
1 27 2 0
25 30 1 0
27 23 1 0
7 22 2 0
2 10 2 0
1 12 1 0
29 17 1 0
20 7 1 0
3 31 1 0
25 19 1 0
20 6 1 0
24 18 1 0
7 26 1 0
21 24 1 0
6 15 2 0
8 10 1 0
16 32 2 0
33 5 1 0
34 33 1 0
5 34 1 0
18 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.66Molecular Weight (Monoisotopic): 515.1549AlogP: 5.01#Rotatable Bonds: 10Polar Surface Area: 107.36Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.61CX Basic pKa: 6.99CX LogP: 3.60CX LogD: 4.14Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.92
References 1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M. (2021) N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands., 29 [PMID:33309749 ] [10.1016/j.bmc.2020.115859 ]