NA

ID: ALA4747540

PubChem CID: 162649228

Max Phase: Preclinical

Molecular Formula: C26H30ClN7O3

Molecular Weight: 524.03

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCNC(=O)COc2ccc(Cl)cc2C(=O)N2CCCCC2c2cc3nc(N4CCC4)cc1n3n2

Standard InChI:  InChI=1S/C26H30ClN7O3/c1-31-12-8-28-24(35)16-37-21-7-6-17(27)13-18(21)26(36)33-11-3-2-5-20(33)19-14-23-29-22(32-9-4-10-32)15-25(31)34(23)30-19/h6-7,13-15,20H,2-5,8-12,16H2,1H3,(H,28,35)

Standard InChI Key:  JMRARQYMVODNGG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    6.9503  -10.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9503  -11.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6624  -12.0839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6624  -10.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3745  -10.8505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3789  -11.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1616  -11.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6409  -11.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1543  -10.5924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4613  -11.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8765  -11.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6980  -11.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1104  -11.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6951  -10.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8675  -10.5316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4517   -9.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8610   -9.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6267   -9.8226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6850   -9.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0942   -8.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6785   -7.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8492   -7.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4437   -8.3971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6187   -8.4049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9479   -9.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2383  -12.0864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4412  -11.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2287  -12.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0260  -12.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9193   -8.3850    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.1994   -7.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3745   -7.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9552   -6.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9687   -8.4206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6045   -8.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6379   -9.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6586   -9.6088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  8 10  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
  4 37  1  0
 37 25  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 26  1  0
  2 26  1  0
 20 30  1  0
 24 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4747540

    ---

Associated Targets(non-human)

F Fusion glycoprotein F0 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.03Molecular Weight (Monoisotopic): 523.2099AlogP: 2.90#Rotatable Bonds: 1
Polar Surface Area: 95.31Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.31CX Basic pKa: 3.74CX LogP: 2.78CX LogD: 2.78
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.10

References

1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M.  (2020)  Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties.,  28  (24): [PMID:33190073] [10.1016/j.bmc.2020.115818]

Source