6-[(2-aminoanilino)methyl]-1-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4747542

PubChem CID: 162649230

Max Phase: Preclinical

Molecular Formula: C18H16N6O

Molecular Weight: 332.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ccccc1NCc1nc2c(cnn2-c2ccccc2)c(=O)[nH]1

Standard InChI:  InChI=1S/C18H16N6O/c19-14-8-4-5-9-15(14)20-11-16-22-17-13(18(25)23-16)10-21-24(17)12-6-2-1-3-7-12/h1-10,20H,11,19H2,(H,22,23,25)

Standard InChI Key:  NODXIPZYXYPCBA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    4.6787   -5.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9703   -5.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9703   -6.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6812   -6.8955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3873   -6.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3873   -5.6658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1038   -6.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8160   -6.4864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5282   -6.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2449   -6.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9576   -6.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9576   -7.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2474   -8.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5282   -7.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2449   -5.6616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1863   -6.7448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7032   -6.0789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1864   -5.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9717   -7.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1738   -7.7537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9619   -8.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5460   -9.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3435   -8.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5540   -8.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6787   -4.4316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  1  0
  7  5  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 10 15  1  0
  3 16  1  0
 16 17  1  0
 17 18  2  0
  2 18  1  0
 19 16  1  0
 19 20  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 24 19  2  0
  1 25  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4747542

    ---

Associated Targets(Human)

PDE5A Tclin Phosphodiesterase 5A (5113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Corpus cavernosum (27 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.37Molecular Weight (Monoisotopic): 332.1386AlogP: 2.30#Rotatable Bonds: 4
Polar Surface Area: 101.62Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 8.95CX Basic pKa: 3.96CX LogP: 1.27CX LogD: 1.26
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.50Np Likeness Score: -1.87

References

1. Shaaban MA,Elshaier YAMM,Hammad AH,Farag NA,Hassan Haredy H,AbdEl-Ghany AA,Mohamed KO.  (2020)  Design and synthesis of pyrazolo[3,4-d]pyrimidinone derivatives: Discovery of selective phosphodiesterase-5 inhibitors.,  30  (16): [PMID:32631538] [10.1016/j.bmcl.2020.127337]

Source