2-[[1-(cyclopropylmethylsulfonyl)-4-piperidyl]amino]-8-[(1R,2R)-2-hydroxy-2-methyl-cyclopentyl]pyrido[2,3-d]pyrimidin-7-one

ID: ALA4747638

PubChem CID: 134247578

Max Phase: Preclinical

Molecular Formula: C22H31N5O4S

Molecular Weight: 461.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]1(O)CCC[C@H]1n1c(=O)ccc2cnc(NC3CCN(S(=O)(=O)CC4CC4)CC3)nc21

Standard InChI:  InChI=1S/C22H31N5O4S/c1-22(29)10-2-3-18(22)27-19(28)7-6-16-13-23-21(25-20(16)27)24-17-8-11-26(12-9-17)32(30,31)14-15-4-5-15/h6-7,13,15,17-18,29H,2-5,8-12,14H2,1H3,(H,23,24,25)/t18-,22-/m1/s1

Standard InChI Key:  XZKHOZLKTBKGNZ-XMSQKQJNSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   30.4259   -6.2404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8387   -6.9503    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.2471   -6.2379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3784   -7.3671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3773   -8.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0853   -8.5956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0835   -6.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7921   -7.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7909   -8.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5010   -8.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2169   -8.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2181   -7.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5034   -6.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9234   -8.6013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5021   -9.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8397   -9.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0900  -10.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9073  -10.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1619   -9.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9397   -9.6505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7394  -10.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6692   -8.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9618   -8.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9619   -7.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2586   -6.9596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5481   -7.3641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5455   -8.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533   -8.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1327   -7.3577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1326   -8.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7287   -8.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5459   -8.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 11 14  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 15 10  1  1
 19 20  1  0
 19 21  1  1
  5 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26  2  1  0
  2 29  1  0
 29 30  1  0
 31 30  1  0
 32 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4747638

    ---

Associated Targets(Human)

CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E1 (1877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.59Molecular Weight (Monoisotopic): 461.2097AlogP: 1.88#Rotatable Bonds: 6
Polar Surface Area: 117.42Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.68CX LogP: 0.53CX LogD: 0.53
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.67Np Likeness Score: -0.57

References

1. Abdel-Magid AF..  (2021)  Potential of Cyclin-Dependent Kinase Inhibitors as Cancer Therapy.,  12  (2): [PMID:33603963] [10.1021/acsmedchemlett.1c00017]

Source