The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4748044
PubChem CID: 162649636
Max Phase: Preclinical
Molecular Formula: C23H25BrO6
Molecular Weight: 477.35
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C[C@]23C[C@@]1(O)CC[C@H]2c1cc(Br)c(O/C=C/C(=O)OC)c(C)c1[C@@H]3C(=O)OC
Standard InChI: InChI=1S/C23H25BrO6/c1-12-10-22-11-23(12,27)7-5-15(22)14-9-16(24)20(30-8-6-17(25)28-3)13(2)18(14)19(22)21(26)29-4/h6,8-9,15,19,27H,1,5,7,10-11H2,2-4H3/b8-6+/t15-,19+,22-,23-/m0/s1
Standard InChI Key: WQCBQFJQHDPMTF-RJOFGYDHSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
16.7277 -10.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7277 -11.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4206 -11.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4206 -9.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1135 -10.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1179 -11.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8808 -11.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3544 -10.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8735 -10.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0782 -9.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1625 -10.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8167 -8.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6864 -10.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5279 -9.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4128 -12.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1313 -12.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5985 -12.7023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9146 -12.2695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4525 -10.3059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6374 -9.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2388 -8.9135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4592 -11.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0199 -11.5149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3122 -11.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3124 -10.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6047 -9.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6049 -9.0631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8970 -10.2887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1893 -9.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0190 -9.8947 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
18.2877 -9.4679 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
9 5 1 0
8 9 1 0
9 10 1 0
8 11 1 1
10 12 1 0
11 13 1 0
12 14 1 0
13 14 1 0
3 15 1 0
7 16 1 1
16 17 2 0
16 18 1 0
13 19 2 0
14 20 1 0
8 20 1 0
14 21 1 6
18 22 1 0
2 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
1 30 1 0
9 31 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.35Molecular Weight (Monoisotopic): 476.0835AlogP: 4.04#Rotatable Bonds: 4Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.69CX LogD: 3.69Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: 1.93
References 1. Annand JR,Henderson AR,Cole KS,Maurais AJ,Becerra J,Liu Y,Weerapana E,Koehler AN,Mapp AK,Schindler CS. (2020) Gibberellin JRA-003: A Selective Inhibitor of Nuclear Translocation of IKKα., 11 (10): [PMID:33062173 ] [10.1021/acsmedchemlett.9b00613 ]