N-((2-(2,6-Dioxopiperidin-3-yl)-1-oxoisoindolin-5-yl)-methyl)-2,2-Difluoro-2-phenylocetamide

ID: ALA4748085

PubChem CID: 118647258

Max Phase: Preclinical

Molecular Formula: C22H19F2N3O4

Molecular Weight: 427.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCC(N2Cc3cc(CNC(=O)C(F)(F)c4ccccc4)ccc3C2=O)C(=O)N1

Standard InChI:  InChI=1S/C22H19F2N3O4/c23-22(24,15-4-2-1-3-5-15)21(31)25-11-13-6-7-16-14(10-13)12-27(20(16)30)17-8-9-18(28)26-19(17)29/h1-7,10,17H,8-9,11-12H2,(H,25,31)(H,26,28,29)

Standard InChI Key:  XGBDIBOYKIRRPQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   30.1123  -12.9843    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.5250  -13.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9334  -12.9818    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.3590  -12.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3578  -13.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0659  -14.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0641  -12.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7727  -12.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7730  -13.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5559  -13.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0396  -13.2845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5555  -12.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8569  -13.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2645  -13.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0781  -13.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4903  -13.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0827  -12.5815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2629  -12.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3075  -13.2937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8548  -11.8702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8078  -11.8415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6498  -14.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9424  -13.6953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2344  -14.1034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8190  -14.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1150  -13.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4075  -14.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4064  -14.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1188  -15.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8234  -14.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2337  -14.9206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 11 13  1  0
 16 19  2  0
 18 20  2  0
 12 21  2  0
  5 22  1  0
 22 23  1  0
 23 24  1  0
 24  2  1  0
  2 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 24 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4748085

    ---

Associated Targets(Human)

KG-1 (867 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
THLE-2 (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.41Molecular Weight (Monoisotopic): 427.1344AlogP: 1.86#Rotatable Bonds: 5
Polar Surface Area: 95.58Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.48CX Basic pKa: CX LogP: 1.67CX LogD: 1.66
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.71Np Likeness Score: -0.35

References

1. Hansen JD,Correa M,Alexander M,Nagy M,Huang D,Sapienza J,Lu G,LeBrun LA,Cathers BE,Zhang W,Tang Y,Ammirante M,Narla RK,Piccotti JR,Pourdehnad M,Lopez-Girona A.  (2021)  CC-90009: A Cereblon E3 Ligase Modulating Drug That Promotes Selective Degradation of GSPT1 for the Treatment of Acute Myeloid Leukemia.,  64  (4.0): [PMID:33591756] [10.1021/acs.jmedchem.0c01489]

Source